Structure |
Chemical Name |
CAS |
MF |
 |
Olodaterol Impurity 23 |
|
|
 |
Miglitol Isomer impurities C |
|
|
 |
Alpha-D-Methylglucoside |
|
|
 |
4-Desacetyl Vincristine |
3704-01-6 |
C44H54N4O9 |
 |
Relugolix Impurity 91 |
|
|
 |
D,L N-Desmethylvenlafaxine |
149289-30-5 |
C16H25NO2 |
 |
Bupivacaine Impurity |
780736-98-3 |
C14H20N2O |
![rel-(4aR,7aR)-6-Benzyloctahydro-1H-pyrrolo[3,4-b]pyridine](../cas/20210111/gif/161594-54-3.gif) |
rel-(4aR,7aR)-6-Benzyloctahydro-1H-pyrrolo[3,4-b]pyridine |
161594-54-3 |
C14H20N2 |
 |
1,2-bis(4-(3-(trifluoromethyl)phenyl)piperazin-1-yl)ethane |
51299-16-2 |
C24H28F6N4 |
 |
(R)-N-(1-(7,8-dihydronaphthalen-1-yl)ethyl)-3-(3-(trifluoromethyl)phenyl)propan-1-amine |
802918-35-0 |
C22H24F3N |
 |
Demiditraz racemate |
944263-08-5 |
C13H16N2 |
 |
Ropivacaine-iPr |
175888-75-2 |
C17H26N2O |
 |
Demiditraz IMpurity |
944267-48-5 |
C19H18N2O |
 |
Apremilast impurity 18 |
1407140-51-5 |
C20H32N2O6S |
 |
Betamethasone EP Impurity F |
330157-04-5 |
C22H28O4 |
 |
Capecitabine Impurity 8 |
|
|
 |
Carfilzomib Impurity D |
|
|
 |
Cefodizime Impurity 4 |
|
|
 |
PraMipexole IMpurity V (PraMipexole IMpurity Z) |
|
|
 |
Prasugrel Acetyl IMpurity |
1443034-67-0 |
C18H18FNO3S |
 |
Propofol IMpurity G |
|
|
 |
SalMeterol IMpurity A |
|
C25H37NO4 |
 |
Sitagliptin Defuoro IMpurity 3 |
851307-12-5 |
C15H19F2NO4 |
 |
Sitagliptin N-Boc IMpurity |
486460-23-5 |
C21H23F6N5O3 |
 |
SulbactaM IMpurity D |
|
|
 |
Valsartan N2-Trityl IMpurity |
|
|
 |
Vardenafil IMpurity 3 |
1255919-01-7 |
C26H30N6O4S |
 |
Montelukast Cyclopropaneacetonitrile |
866923-62-8 |
C35H35ClN2OS |
 |
(3R,4R,5R,6S)-2-(acetoxyMethyl)-6-(4-chloro-3-(4-ethoxybenzyl)phenyl)tetrahydro-2H-pyran-3,4,5-triyl triacetate |
461432-24-6 |
C22H27ClO7 |
 |
Ezetimibe Impurity |
1510820-22-0 |
C24H23F2NO2 |
 |
10,13-bissidechainpaclitaxel |
|
|
 |
Cefradine impurity 5 |
1379292-16-6 |
C10H17NO2 |
 |
Clopidogrel Impurity 13 |
2173294-69-2 |
C16H16ClNO5S2 |
 |
DecitaBine Impurity 12 |
|
|
 |
Erlotinib Impurity 28 |
|
|
 |
Fosaprepitant Impurity 12 |
172673-19-7 |
C23H22F7N4O6P |
 |
Ibuprofen Impurity 2 |
|
C13H18O2 |
 |
Imatinib Impurity 9 |
|
|
 |
Isavuconazole Impurity 22 |
|
|
 |
Isavuconazole Impurity 28 |
|
|
 |
Levothyroxine Impurity 16 |
909279-46-5 |
C15H11ClI3NO4 |
 |
Linagliptin Impurity 42 |
|
|
 |
PalBociclib Impurity 25 |
|
|
 |
Posaconazole Impurity 13 |
357189-98-1 |
C37H40F2N8O6 |
 |
Posaconazole Impurity 25 |
1042398-26-4 |
C16H19F2IO3 |
 |
Posaconazole Impurity 42 |
357189-96-9 |
C36H40F2N8O5 |
 |
Posaconazole Impurity 65 |
|
|
 |
Pramipexole Dimer Impurity (Mixture of Diastereomers) |
1147937-31-2 |
C13H23N3S |
 |
Sitafloxacin Impurity 1 |
|
|
 |
Sitagliptin Impurity 25 |
|
|
 |
sofosBuvir impurity 47 |
|
|
 |
SofosBuvir Impurity 64 |
|
|
 |
Tofacitinib Impurity W |
|
|
 |
Trelagliptin Impurity 21 |
|
|
 |
4'-Hydroxy TorseMide |
99300-67-1 |
C16H20N4O4S |
 |
Hydroxyzine Acetic Acid Dihydrochloride |
83881-56-5 |
C23H29ClN2O4 |
 |
(S)-Duloxetine SuccinaMide |
199191-66-7 |
C22H23NO4S |
 |
4-Acetyl Rhein |
875535-36-7 |
C17H10O7 |
 |
1-(2,6-dichlorophenyl)piperazine |
63386-61-8 |
C10H12Cl2N2 |
 |
Ropivacaine N-Oxide |
1391053-59-0 |
C17H26N2O2 |
 |
Istradefylline Impurity A |
|
|
 |
(3R,4S)-1-benzyl-N,4-diMethylpiperidin-3-aMine dihydrochloride |
|
C14H24Cl2N2 |
![2-(((3-Methyl-4-nitropyridin-2-yl)Methyl)sulfinyl)-1H- benzo[d]iMidazole](../cas/20150408/gif/142384-07-4.gif) |
2-(((3-Methyl-4-nitropyridin-2-yl)Methyl)sulfinyl)-1H- benzo[d]iMidazole |
142384-07-4 |
C14H12N4O3S |
 |
Valsartan Desvaleryl Impurity |
676129-92-3 |
C19H21N5O2 |
 |
Istradefylline iMpurity |
|
|
 |
(E)-Olopatadine Hydrochloride |
949141-22-4 |
C21H24ClNO3 |
![(3R,4R,5R)-3-(1-Ethylpropoxy)-4-hydroxy-5-[(Methylsulfonyl)oxy]-1-cyclohexene-1-carboxylic Acid Ethyl Ester](../cas/gif/204254-92-2.gif) |
(3R,4R,5R)-3-(1-Ethylpropoxy)-4-hydroxy-5-[(Methylsulfonyl)oxy]-1-cyclohexene-1-carboxylic Acid Ethyl Ester |
204254-92-2 |
C15H26O7S |
![(R)-α-[(2,2-DiMethyl-1-oxopropyl)aMino]-4-hydroxybenzeneacetic Acid](../cas/gif/205826-86-4.gif) |
(R)-α-[(2,2-DiMethyl-1-oxopropyl)aMino]-4-hydroxybenzeneacetic Acid |
205826-86-4 |
C13H17NO4 |
 |
8-Hydroxy Pitavastatin |
224320-09-6 |
C25H24FNO5 |
 |
α-Decitabine |
22432-95-7 |
C8H12N4O4 |
 |
Aloin Peracetate |
64951-96-8 |
C37H38O17 |
![L-Alanine, N-[(2,3,4,5,6-pentafluorophenoxy)phenoxyphosphinyl]-, 1-Methylethyl ester](../cas/20150408/gif/1256490-52-4.gif) |
L-Alanine, N-[(2,3,4,5,6-pentafluorophenoxy)phenoxyphosphinyl]-, 1-Methylethyl ester |
1256490-52-4 |
C18H17F5NO5P |
 |
Cefditoren iMpurity 2, Cefditoren open ring |
|
|
 |
Ceftriaxone IMpurity C |
|
|
 |
Etoricoxib iMpurity 2 |
|
|
 |
Lorcaserin iMpurity D |
1030624-36-2 |
C11H14ClNO2 |
 |
Ticagrelor IMpurity L (Mixture of DiastereoMers) |
|
|
![α-Hydroxy-α-3-thienyl-2-thiopheneacetic Acid 9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl Ester](../cas/20180808/gif/783273-13-2.gif) |
α-Hydroxy-α-3-thienyl-2-thiopheneacetic Acid 9-Methyl-3-oxa-9-azatricyclo[3.3.1.02,4]non-7-yl Ester |
783273-13-2 |
C18H19NO4S2 |
![3H-4,7a-Methanocyclohept[3,3a]indeno[5,4-b]oxete Benzenepropanoic Acid Derivative](../cas/20150408/gif/146139-03-9.gif) |
3H-4,7a-Methanocyclohept[3,3a]indeno[5,4-b]oxete Benzenepropanoic Acid Derivative |
146139-03-9 |
C47H51NO14 |
 |
Fluvastatin 3-Hydroxy-4,6-diene |
1207963-21-0 |
C24H24FNO3 |
 |
Cyclosporine iMpurity |
|
|
 |
ThiaMine IMpurity |
|
C12H17ClN4OS |
 |
CitalopraM IMpurity |
|
|
![tert-butyl 4-(6-((6-acetyl-8-cyclopentyl-5-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-yl)amino)pyridin-3-yl)piperazine-1-carboxylate](../cas/20180629/gif/1651214-74-2.gif) |
tert-butyl 4-(6-((6-acetyl-8-cyclopentyl-5-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-yl)amino)pyridin-3-yl)piperazine-1-carboxylate |
1651214-74-2 |
C29H37N7O4 |
 |
Prasugrel Impurity 4 HCl |
1618107-96-2 |
C20H22Cl2FNO3S |
 |
Tofacitinib Impurity K |
|
|
 |
N-(3-chloro-4-fluorophenyl)-7 -methoxy-6-(3-morpholinopropoxy)-N-(3-morpholinopropyl)quinazolin-4-amine |
1502829-45-9 |
C29H37ClFN5O4 |
 |
5-(hydroxymethyl)-1,2-dihydro-1,2,4-triazol-3-one |
24021-90-7 |
C3H5N3O2 |
![( 2-{4-[N-(5,6-diphenylpyrazin-2-yl)-N-isopropylamino]butyloxy}acetic acid tert-butylester )](../cas/20180702/gif/475084-96-9.gif) |
( 2-{4-[N-(5,6-diphenylpyrazin-2-yl)-N-isopropylamino]butyloxy}acetic acid tert-butylester ) |
475084-96-9 |
C29H37N3O3 |
 |
N-(4-Hydroxymethylbenzyl) Cyclam |
176252-20-3 |
C18H32N4O |
 |
Alvimopan Impurity 3 |
|
|
 |
Nicergoline Impurity G |
|
|
 |
Isavuconazole Impurity 1 |
2069200-13-9 |
C13H12F2N4O |
 |
Sofosbuvir Impurity23 |
|
|
 |
Tacrolimus Impurity 1 |
|
|
 |
Bisoprolol EP Impurity F |
1798418-82-2 |
C18H31NO4 |
 |
Pantoprazole EP Impurity F |
721924-06-7 |
C17H17F2N3O4S |
 |
Rosuvastatin EP Impurity E |
|
|
 |
Tiotropium EP Impurity C |
136310-95-7 |
C19H22BrNO3S2 |
 |
Eliglustat intermediate 4 |
491833-27-3 |
C23H30N2O4 |