|
| | Ethyl (2,4,6-trimethylbenzoyl) phenylphosphinate Basic information | | Uses |
| | Ethyl (2,4,6-trimethylbenzoyl) phenylphosphinate Chemical Properties |
| Melting point | 144.5-147 °C(lit.) | | Boiling point | 456.0±55.0 °C(Predicted) | | density | 1.14 | | vapor pressure | 0Pa at 20℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | 71.8g/L in organic solvents at 20 ℃ | | form | Oil to Thick Oil | | color | Colourless to Yellow | | Water Solubility | 35mg/L at 25℃ | | InChI | InChI=1S/C18H21O3P/c1-5-21-22(20,16-9-7-6-8-10-16)18(19)17-14(3)11-13(2)12-15(17)4/h6-12H,5H2,1-4H3 | | InChIKey | ZMDDERVSCYEKPQ-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC=C1)(C(=O)C1=C(C)C=C(C)C=C1C)(OCC)=O | | LogP | 2.91 at 25℃ | | CAS DataBase Reference | 84434-11-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 2 | | RTECS | DJ0700000 |
| | Ethyl (2,4,6-trimethylbenzoyl) phenylphosphinate Usage And Synthesis |
| Uses | Ethyl (2,4,6-trimethylbenzoyl) phenylphosphinate(Photoinitiator TPO-L) is a liquid photoinitiator for low yellowing, low odor formulations, commonly used in screen printing inks, lithographic printing inks, flexo printing inks, photoresists, varnishes, printing Plates and other fields. | | Uses | P-Phenyl-P-(2,4,6-trimethylbenzoyl)-Phosphinic acid Ethyl Ester is a photoinitiator for UV curable coatings. | | Definition | ChEBI: Ethyl (mesitylcarbonyl)phenylphosphinate is a member of benzoic acids. | | Flammability and Explosibility | Nonflammable |
| | Ethyl (2,4,6-trimethylbenzoyl) phenylphosphinate Preparation Products And Raw materials |
|
