|
Product Name: | Methyl 5-chloro-6-methylpyrazine-2-carboxylate | Synonyms: | 5-Chloro-6-methyl-2-pyrazinecarboxylic acid methyl ester;Methyl 5-chloro-6-methylpyrazine-2-carboxylate;5-Chloro-6-methyl-pyrazine-2-carboxylic acid methyl ester;N-1H-BENZIMIDAZOL-4-YLFORMAMIDE;2-Pyrazinecarboxylic acid, 5-chloro-6-methyl-, methyl ester;Methyl 5-chloro-6-methylpyrazine-2-carboxylate ISO 9001:2015 REACH;1,4-Butanediamine,N1,N4-bis(7-chloro-5-quinolinyl)- | CAS: | 77168-85-5 | MF: | C7H7ClN2O2 | MW: | 186.6 | EINECS: | | Product Categories: | | Mol File: | 77168-85-5.mol |  |
| Methyl 5-chloro-6-methylpyrazine-2-carboxylate Chemical Properties |
Melting point | 40-43℃ | Boiling point | 260℃ | density | 1.314 | Fp | 111℃ | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | form | powder | pka | -3.86±0.10(Predicted) | color | Yellow |
| Methyl 5-chloro-6-methylpyrazine-2-carboxylate Usage And Synthesis |
Pharmaceutical intermediate | The N-methyl-d-aspartate (NMDA) receptor is arguably an important signaling mechanism in the human brain and NMDA receptors play a critical role in regulating the strength of synapses, that is, in regulating synaptic plasticity. Methyl 5-chloro-6-methylpyrazine-2-carboxylate is the key materials to prepare the NMDA receptor.
| Uses | Methyl 5-?Chloro-?6-?methylpyrazine-?2-?carboxylate is a reactant used in the synthesis of 4,5-dihydro-5-oxo-2-pyrazinecarboxylic acid 1-oxides. |
| Methyl 5-chloro-6-methylpyrazine-2-carboxylate Preparation Products And Raw materials |
|