|
| | (1-Bromoethyl)benzene Basic information |
| Product Name: | (1-Bromoethyl)benzene | | Synonyms: | (±)-1-bromo-1-phenyl-ethane;(1-bromoethyl)-benzen;A-METHYLBENZYL BROMIDE;1-PHENYLETHYL BROMIDE;(1-BROMOETHYL)BENZENE;α-Methylbenzyl bromide;(1-Bromoethyl)benzene, 97% (alpha-Methybenzylbromide);(1-Bromoethyl)benzene,97% | | CAS: | 585-71-7 | | MF: | C8H9Br | | MW: | 185.06 | | EINECS: | 209-560-2 | | Product Categories: | Benzene derivates | | Mol File: | 585-71-7.mol |  |
| | (1-Bromoethyl)benzene Chemical Properties |
| Melting point | -65°C | | Boiling point | 94 °C/16 mmHg (lit.) | | density | 1.356 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.56(lit.) | | Fp | 179 °F | | storage temp. | Inert atmosphere,2-8°C | | solubility | Soluble in alcohol, ether, and benzene. | | form | Liquid | | color | Clear yellow to brownish | | Sensitive | Moisture Sensitive | | BRN | 507210 | | InChI | InChI=1S/C8H9Br/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3 | | InChIKey | CRRUGYDDEMGVDY-UHFFFAOYSA-N | | SMILES | C1(C(Br)C)=CC=CC=C1 | | CAS DataBase Reference | 585-71-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, (1-bromoethyl)-(585-71-7) | | EPA Substance Registry System | (1-Bromoethyl)benzene (585-71-7) |
| | (1-Bromoethyl)benzene Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW TO BROWNISH LIQUID | | Uses | (1-Bromoethyl)benzene has been employed in controlled radical polymerization of styrene, in asymmetric esterification of benzoic acid in the presence of a chiral cyclic guanidine and as initiator in the synthesis of bromine terminated polyp-methoxystyrene and polystyrene via atom transfer radical polymerization. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 48, p. 1678, 1983 DOI: 10.1021/jo00158a018
Synthesis, p. 383, 1981 |
| | (1-Bromoethyl)benzene Preparation Products And Raw materials |
|
