|
| | Prezatide copper acetate Basic information |
| Product Name: | Prezatide copper acetate | | Synonyms: | Prezatide copper acetate;GHK-Cu, >=98%;Copper peptide, Copper Tripeptide-3, AHK Copper;Anti-allergic & Skin Repair Series AHK - Cu /GHK-Cu/ Copper Peptide;Copper Tripeptide-3 (AHK-Cu);Tripeptide-1 copper (copper peptide);Pure copper peptide ghk-cu/ghk cu copper tripeptide-1 prezatide copper acetate;copper,aceticacid,(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoicaci | | CAS: | 130120-57-9 | | MF: | C30H48CuN12O10 | | MW: | 800.33 | | EINECS: | 000-000-0 | | Product Categories: | APIs;130120-57-9 | | Mol File: | 130120-57-9.mol |  |
| | Prezatide copper acetate Chemical Properties |
| InChIKey | VJKXESGORYEAGC-UHFFFAOYSA-K | | SMILES | C(=O)(O)C.C(C1CC2=CNC=N2[Cu+2]2(N3C=NC(CC(NC(=O)CN)C(=O)NC(C(=O)[O-])CCCCN)=C3)NCC(=O)[N-]12)(=O)NC(C(=O)[O-])CCCCN.[H+] | | LogP | -2.241 (est) |
| | Prezatide copper acetate Usage And Synthesis |
| Description | Iamin gel was launched in the US for the care of chronic and acute wounds.
It can be prepared by combining the tripeptide GHK and copper (Ⅱ) acetate. There
are several species present in equilibrium but the biscomplex is the dominant
compound at neutral pH. The GHK sequence is found in only eight human proteins
and is an endogenous growth factor that stimulates collagen synthesis and
angiogenesis. This is part of the explanation for its wound healing and tissue repair
ability. It can significantly delay fibroblast activation, is a growth factor for
hepatocyctes, neurons, thyroid follicular cells and is a chemoattractant for
monocytes, macrophages, mast cells and capillary endothelial cells. Copper is also
known to have an effect on lysyl oxidase which is a key enzyme involved in collagen
formation. | | Originator | ProCyte (USA) | | Uses | anti-wrikle | | Brand name | Iamin (ProCyte). |
| | Prezatide copper acetate Preparation Products And Raw materials |
|
