|
| | 6-(4-Hydroxyphenoxy)hexyl acrylate Basic information |
| Product Name: | 6-(4-Hydroxyphenoxy)hexyl acrylate | | Synonyms: | 4-(6-ACRYLOXY-HEX-1-YL-OXY)PHENOL;2-Propenoic acid,6-(4-hydroxyphenoxy)hexyl ester;4-(6-Acryloyloxyhex-1-yloxy)phenol;4-((6-(Acryloyloxy)hexyl)oxy)phenol;4-(6-Acryloyloxy-n-hex-1-yloxy)phenol;4-[(6-Acryloxy)hexyloxy]phenol;4-[6-(Acryloyloxy)hexyloxy]pheno;6-(4-Hydroxyphenoxy)hexyl acrylate | | CAS: | 161841-12-9 | | MF: | C15H20O4 | | MW: | 264.32 | | EINECS: | | | Product Categories: | Other | | Mol File: | 161841-12-9.mol |  |
| | 6-(4-Hydroxyphenoxy)hexyl acrylate Chemical Properties |
| Melting point | 55℃ (water ) | | Boiling point | 407.6±25.0 °C(Predicted) | | density | 1.090±0.06 g/cm3(Predicted) | | form | solid | | pka | 10.33±0.15(Predicted) | | color | off-white | | InChI | InChI=1S/C15H20O4/c1-2-15(17)19-12-6-4-3-5-11-18-14-9-7-13(16)8-10-14/h2,7-10,16H,1,3-6,11-12H2 | | InChIKey | VWDSGKYABCFREO-UHFFFAOYSA-N | | SMILES | C(OCCCCCCOC1=CC=C(O)C=C1)(=O)C=C |
| | 6-(4-Hydroxyphenoxy)hexyl acrylate Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | 6-(4-Hydroxyphenoxy)hexyl acrylate is used in organic synthesis and pharmaceutical intermediates. | | Preparation | The preparation of 6-(4-Hydroxyphenoxy)hexyl acrylate is as follows:10 g (47.56 mmol) of 4-(6-hydroxyhexyloxy)phenol, 50 ml (551.7 mmol)Methyl acrylate, 0.36g (3.75mmol)Methanesulfonic acid was added to the reaction flask, heated to 40 ° C, reacted for 3 hours, and distilled under reduced pressure.The reaction solution was added to water and stirred with methyl tert-butyl ether.The organic layer was collected, concentrated to dryness, and then filtered with ethyl t-butyl ether and n-heptane.After drying, 12.0 g of an off-white solid was obtained in a yield of 95.5%.The content is ≥98.5%. 
| | storage | Low temperature and keep dry. |
| | 6-(4-Hydroxyphenoxy)hexyl acrylate Preparation Products And Raw materials |
|
