|
| | 3,4,5-Trifluorophenol Basic information |
| Product Name: | 3,4,5-Trifluorophenol | | Synonyms: | 3,4,5-Trifluorophenol, 97+%;Phenol, 3,4,5-trifluoro- (9CI);3,4,5-Trifluorphenol;3,4,5-TRIFLUOROPHENOL 99.5%;3,4,5-TRIFLUOROPHENOL 99.5% UV 360 USED IN LCD PRODUCTION;3,4,5-TRIFLUOROPHENOL 99.5% UV 327 USED IN LCD PRODUCTION;3,4,5-Trifluorophenol 99%;3,4,5-Trifluorophenol99% | | CAS: | 99627-05-1 | | MF: | C6H3F3O | | MW: | 148.08 | | EINECS: | 436-120-9 | | Product Categories: | Fluorophenols;HALIDE;Phenol&Thiophenol&Mercaptan;Organic Building Blocks;Oxygen Compounds;Phenols;blocks;FluoroCompounds;Aromatic Phenols;phenol series | | Mol File: | 99627-05-1.mol |  |
| | 3,4,5-Trifluorophenol Chemical Properties |
| Melting point | 52-55 °C | | Boiling point | 177°C | | density | 1.629 g/cm3 (20℃) | | vapor pressure | 1.7hPa at 25℃ | | Fp | 177°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | 104g/l OECD Test Guideline 105 | | pka | 8.00±0.23(Predicted) | | form | Crystals or Low Melting Solid | | color | Colorless to pale yellow | | Water Solubility | 104g/L at 20℃ | | BRN | 8830884 | | InChI | InChI=1S/C6H3F3O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H | | InChIKey | ZRTWIJKGTUGZJY-UHFFFAOYSA-N | | SMILES | C1(O)=CC(F)=C(F)C(F)=C1 | | LogP | 1.9 at 20℃ | | CAS DataBase Reference | 99627-05-1(CAS DataBase Reference) |
| | 3,4,5-Trifluorophenol Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3,4,5-Trifluorophenol may be used in the synthesis of 3,4,5-trifluorophenoxymethyl-substituted polystyrene. | | Uses | Intermediates of Liquid Crystals | | General Description | 3,4,5-Trifluorophenol is a halo-substituted phenol. It participates in the synthesis of difluorooxymethylene-bridged liquid crystals. | | Flammability and Explosibility | Notclassified |
| | 3,4,5-Trifluorophenol Preparation Products And Raw materials |
|
