|
| | Tosufloxacin tosilate Basic information |
| Product Name: | Tosufloxacin tosilate | | Synonyms: | Tosufloxacin Tosylate Monohydrate;TOSUFLOXACIN TOSILATE;Tosufloxacin tosilate###TOSUFLOXACIN TOSILATE;Tosufloxacin tosilate hydrate;7-(3-Aminopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid 4-methylbenzenesulfonate hydrate;Tosufloxacin hydrate;Tosufloxacin monohydrate;Unii-6239812J7l | | CAS: | 107097-79-0 | | MF: | C19H17F3N4O4 | | MW: | 422.36 | | EINECS: | 1308068-626-2 | | Product Categories: | API | | Mol File: | 107097-79-0.mol |  |
| | Tosufloxacin tosilate Chemical Properties |
| Melting point | approximate 254℃ (dec.) | | InChI | InChI=1S/C19H15F3N4O3.H2O/c20-9-1-2-15(13(21)5-9)26-8-12(19(28)29)16(27)11-6-14(22)18(24-17(11)26)25-4-3-10(23)7-25;/h1-2,5-6,8,10H,3-4,7,23H2,(H,28,29);1H2 | | InChIKey | FCHGAGZTPICOSW-UHFFFAOYSA-N | | SMILES | O=C1C(=CN(C2C=CC(F)=CC=2F)C2=NC(N3CCC(N)C3)=C(F)C=C12)C(=O)O.O | | CAS DataBase Reference | 107097-79-0(CAS DataBase Reference) |
| | Tosufloxacin tosilate Usage And Synthesis |
| Definition | ChEBI: Tosufloxacin tosylate hydrate is a racemate comprising equimolar amounts of (R)- and (S)-tosufloxacin tosylate hydrate. It has a role as an antimicrobial agent, an antiinfective agent, a DNA synthesis inhibitor, a hepatotoxic agent and a topoisomerase IV inhibitor. It contains a (S)-tosufloxacin tosylate hydrate, a (R)-tosufloxacin tosylate hydrate and a tosufloxacin tosylate. | | Brand name | Tosufloxacin Tosilate is JAN. |
| | Tosufloxacin tosilate Preparation Products And Raw materials |
|
