|
| 2,3,3-Trimethyl-3H-indole-5-sulfonic acid Basic information |
Product Name: | 2,3,3-Trimethyl-3H-indole-5-sulfonic acid | Synonyms: | 5-Sulfo-2,3,3-trimethyl indolenine sodium salt;Sodium 2,3,3-trimethyl-3H-indole-5-sulfonate;137392;2,3,3-trimethyl-5-indolesulfonic acid;2,3,3-trimethylindole-5-sulfonic acid;3H-Indole-5-sulfonicacid, 2,3,3-trimethyl-;2,3,3-trimethyl-3h-indole-5-sulfonic acid | CAS: | 132557-72-3 | MF: | C11H13NO3S | MW: | 239.29 | EINECS: | | Product Categories: | Piperazine derivates | Mol File: | 132557-72-3.mol | |
| 2,3,3-Trimethyl-3H-indole-5-sulfonic acid Chemical Properties |
density | 1.34 | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | pka | -1.45±0.60(Predicted) | InChI | InChI=1S/C11H13NO3S/c1-7-11(2,3)9-6-8(16(13,14)15)4-5-10(9)12-7/h4-6H,1-3H3,(H,13,14,15) | InChIKey | HUFDYAIAEFHOKI-UHFFFAOYSA-N | SMILES | N1C2=C(C=C(S(O)(=O)=O)C=C2)C(C)(C)C=1C |
| 2,3,3-Trimethyl-3H-indole-5-sulfonic acid Usage And Synthesis |
Uses | Used as pharmaceutical intermediates for RD. |
| 2,3,3-Trimethyl-3H-indole-5-sulfonic acid Preparation Products And Raw materials |
|