|
| | (S)-1-Boc-3-hydroxypiperidine Basic information | | Uses |
| | (S)-1-Boc-3-hydroxypiperidine Chemical Properties |
| Melting point | 34-40 °C | | Boiling point | 292.3±33.0 °C(Predicted) | | density | 1.107±0.06 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | pka | 14.74±0.20(Predicted) | | form | Powder or Crystalline Powder | | color | White to tan | | optical activity | [α]22/D +10.0°, c = 1 in chloroform | | InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-5-8(12)7-11/h8,12H,4-7H2,1-3H3/t8-/m0/s1 | | InChIKey | UIJXHKXIOCDSEB-QMMMGPOBSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@H](O)C1 | | CAS DataBase Reference | 143900-44-1(CAS DataBase Reference) |
| | (S)-1-Boc-3-hydroxypiperidine Usage And Synthesis |
| Uses | (S)-1-Boc-3-hydroxypiperidine is an important chiral intermediate for the synthesis of ibrutinib, an anticancer drug targeting B-cell malignancies. Synthesis of pharmaceutical intermediates including ibrutinib, the API of the newly approved drug Imbruvica, for the treatment of lymphoma. | | Chemical Properties | White powder | | Uses | A piperidine derivative with an amine protecting group, (S)-1-Boc-3-hydroxypiperidine can be used in the preparation of biologically active compounds such as antagonists of the human P2X7 receptor and selective irreversible inhibitors for bruton's tyrosine kinase.
| | Uses | (S)-1-Boc-3-hydroxypiperidine is used as pharmaceutical intermediate. |
| | (S)-1-Boc-3-hydroxypiperidine Preparation Products And Raw materials |
|
