|
| | 2-Methylphenylacetic acid Basic information |
| Product Name: | 2-Methylphenylacetic acid | | Synonyms: | Benzeneacetic acid, 2-methyl-;o-Methylphenylacetic acid;RARECHEM AL BO 0118;O-TOLYLACETIC ACID;2-METHYLPHENYLACETIC ACID;2-TOLYLACETIC ACID;o-Tolylacetic acid 99%;ortho-tolylacetic acid | | CAS: | 644-36-0 | | MF: | C9H10O2 | | MW: | 150.17 | | EINECS: | 211-416-9 | | Product Categories: | | | Mol File: | 644-36-0.mol |  |
| | 2-Methylphenylacetic acid Chemical Properties |
| Melting point | 88-90 °C (lit.) | | Boiling point | 211.72°C (rough estimate) | | density | 0.9820 (rough estimate) | | refractive index | 1.5470 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | pK1:4.36 (18°C) | | form | Crystalline Powder | | color | White to slightly cream | | Water Solubility | insoluble | | BRN | 1936952 | | InChI | InChI=1S/C9H10O2/c1-7-4-2-3-5-8(7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) | | InChIKey | RZWGTXHSYZGXKF-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC=C1C | | CAS DataBase Reference | 644-36-0(CAS DataBase Reference) | | NIST Chemistry Reference | O-tolylacetic acid(644-36-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 1 | | HazardClass | IRRITANT | | HS Code | 29163900 |
| | 2-Methylphenylacetic acid Usage And Synthesis |
| Chemical Properties | white to slightly cream crystalline powder | | Uses | 2-Methylphenylacetic acid is a ring-substituted phenylacetic acid with auxin activity used as a plant growth regulator.
| | Uses | o-Tolylacetic Acid is a ring-substituted phenylacetic acid with auxin activity used as a plant growth regulator. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 51, p. 4354, 1986 DOI: 10.1021/jo00373a005 |
| | 2-Methylphenylacetic acid Preparation Products And Raw materials |
|
