|
| | Lithium bis(oxalate)borate Basic information |
| Product Name: | Lithium bis(oxalate)borate | | Synonyms: | LIBOB;lithium bis(oxalate)borate;LITHIUM BIS(OXALATO)BORATE;CHEMLYTE BO M1;CHEMLYTE BO MX;LITHIUM BIS (OXALATE) BORATE(LiBOB);Borate(1-), bis(ethanedioato(2-)-kappao1,kappao2)-, lithium (1:1), (T-4)-;Borate(1-), bis(ethanedioato(2-)-kappao1,kappao2)-, lithium, (T-4)- | | CAS: | 244761-29-3 | | MF: | C4BLiO8 | | MW: | 193.79 | | EINECS: | 456-990-3 | | Product Categories: | | | Mol File: | 244761-29-3.mol |  |
| | Lithium bis(oxalate)borate Chemical Properties |
| Melting point | >300°C (lit.) | | vapor pressure | 0.004Pa at 20℃ | | storage temp. | Inert atmosphere,Room Temperature | | form | powder or crystals | | Water Solubility | 1015g/L at 20℃ | | InChI | InChI=1S/C4BO8.Li/c6-1-2(7)11-5(10-1)12-3(8)4(9)13-5;/q-1;+1 | | InChIKey | NVQAYVUCVASGDK-UHFFFAOYSA-N | | SMILES | O=C1C([O-][B+3]2([O-]C(=O)C(=O)[O-]2)[O-]1)=O.[Li+] | | LogP | 0 at 20℃ | | EPA Substance Registry System | Borate(1-), bis[ethanedioato(2-)-.kappa.O1,.kappa.O2]-, lithium, (T-4)- (244761-29-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29319090 |
| | Lithium bis(oxalate)borate Usage And Synthesis |
| Uses | Lithium bis(oxalate)borate is a new and proprietary conductive salt for the use in high performance batteries like lithium batteries, lithium ion batteries and lithium polymer batteries. The new halide-free product may be used instead of traditional fluorinated compounds like LiPF6, LiBF4, Li-triflate, methanides, imides etc.
| | Uses | LiBOB is a novel boron based Li salt electrolyte material for Li ion batteries. It is environmentally friendly with good film forming property and high thermal stability and is compatible with a variety of anodes and metal oxide cathode. | | General Description | This product has been enhanced for energy efficiency. | | Flammability and Explosibility | Nonflammable |
| | Lithium bis(oxalate)borate Preparation Products And Raw materials |
|
