|
| | Rosiptor Basic information |
| Product Name: | Rosiptor | | Synonyms: | AQX10;Rosiptor;AQX-1125;AQX1125;ROSIPTOR;Rosiptor(AQX-1125);AQX 1125
(AQX-1125;semaglutide API;Cyclohexanemethanol, 2-[(3aS,4R,5S,7aS)-4-(aminomethyl)octahydro-7a-methyl-1-methylene-1H-inden-5-yl]-5-hydroxy-2-methyl-, (1S,2R,5S)-;Semaglutide-fermented | | CAS: | 782487-28-9 | | MF: | C20H35NO2 | | MW: | 321.5 | | EINECS: | 200-001-8 | | Product Categories: | APIs;782487-28-9 | | Mol File: | 782487-28-9.mol |  |
| | Rosiptor Chemical Properties |
| Boiling point | 451.6±45.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 150 mg/mL (466.56 mM) | | pka | 15.05±0.10(Predicted) | | InChI | InChI=1S/C20H35NO2/c1-13-4-5-17-16(11-21)18(7-9-19(13,17)2)20(3)8-6-15(23)10-14(20)12-22/h14-18,22-23H,1,4-12,21H2,2-3H3/t14-,15+,16+,17+,18+,19-,20+/m1/s1 | | InChIKey | MDEJTPWQNNMAQF-BVMLLJBZSA-N | | SMILES | [C@H]1(CO)C[C@@H](O)CC[C@@]1([C@H]1CC[C@@]2(C)[C@]([H])([C@@H]1CN)CCC2=C)C |
| | Rosiptor Usage And Synthesis |
| | Rosiptor Preparation Products And Raw materials |
|
