|
| 1,4-Bis(hydroxydimethylsilyl)benzene Basic information |
| 1,4-Bis(hydroxydimethylsilyl)benzene Chemical Properties |
Melting point | 133-136 °C(lit.) | Boiling point | 289.6±36.0 °C(Predicted) | density | 1.02±0.1 g/cm3(Predicted) | Fp | >110°C | storage temp. | 2-8°C | pka | 13.91±0.53(Predicted) | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | InChI | InChI=1S/C10H18O2Si2/c1-13(2,11)9-5-7-10(8-6-9)14(3,4)12/h5-8,11-12H,1-4H3 | InChIKey | YBNBOGKRCOCJHH-UHFFFAOYSA-N | SMILES | C1([Si](C)(C)O)=CC=C([Si](C)(C)O)C=C1 | CAS DataBase Reference | 2754-32-7(CAS DataBase Reference) | EPA Substance Registry System | Silanol, 1,4-phenylenebis[dimethyl- (2754-32-7) |
| 1,4-Bis(hydroxydimethylsilyl)benzene Usage And Synthesis |
| 1,4-Bis(hydroxydimethylsilyl)benzene Preparation Products And Raw materials |
|