|
| Product Name: | 4-Amino-3,5-dichlorobenzotrifluoride | | Synonyms: | 3,5-DICHLORO-4-AMINO BENZOTRIFLUORIDE;2,6-DICHLORO-4-(TRIFLUOROMETHYL)ANILINE;BUTTPARK 29\06-100;TIMTEC-BB SBB003283;2,6-dichloro-4-Trifluoromethyllaniline;4-Amino-3,5-dichlorobenzotrifluoride,97% (2,6-Dichloro-4-trifluoromethylaniline);2,6-dichloro-(trifluoromethyl)aniline;2,6-Dichloro-4-(trifluoromethyl)aniline 99% | | CAS: | 24279-39-8 | | MF: | C7H4Cl2F3N | | MW: | 230.01 | | EINECS: | 416-430-0 | | Product Categories: | Building Blocks;Chemical Synthesis;Pesticide Intermediate;Nitrogen Compounds;Organic Building Blocks;amine| alkyl chloride;Anilines, Aromatic Amines and Nitro Compounds;Aniline;Fluorochemicals;API intermediates;Benzenes;Amines;C7;Nitrogen Compounds;Trifluoromethylbenzene serise;Aromatic Halides (substituted);bc0001 | | Mol File: | 24279-39-8.mol |  |
| | 4-Amino-3,5-dichlorobenzotrifluoride Chemical Properties |
| Melting point | 34-36 °C(lit.) | | Boiling point | 60-62 °C1 mm Hg(lit.) | | density | 1.532 g/mL at 25 °C(lit.) | | Fp | 190 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | pka | -1.13±0.10(Predicted) | | form | powder to lump | | Specific Gravity | 1.532 | | color | White to Orange to Green | | BRN | 2838819 | | InChI | InChI=1S/C7H4Cl2F3N/c8-4-1-3(7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 | | InChIKey | ITNMAZSPBLRJLU-UHFFFAOYSA-N | | SMILES | C1(N)=C(Cl)C=C(C(F)(F)F)C=C1Cl | | CAS DataBase Reference | 24279-39-8(CAS DataBase Reference) |
| Hazard Codes | Xn,N,T | | Risk Statements | 20/22-38-43-50/53 | | Safety Statements | 24-37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29214300 |
| | 4-Amino-3,5-dichlorobenzotrifluoride Usage And Synthesis |
| Uses | 2,6-Dichloro-4-(trifluoromethyl)aniline is used in the synthesis of GABA receptor antagonists and insecticides. | | preparation | Using 4-chlorotrifluoromethylbenzene as raw material, 2,6-dichloro-4-trifluoromethylaniline was prepared through two-step reaction of amination and chlorination. | | Chemical Properties | light yellow low melting crystalline mass or | | Uses | 2,6-Dichloro-4-(trifluoromethyl)aniline may be employed for the synthesis of 1-[2,6-di-chloro-4-(tri-fluoro-methyl)-phenyl]-5-[(4-nitro-phenyl)-methyl-ene-imino]-1H-pyrazole-3-carbo-nitrile. |
| | 4-Amino-3,5-dichlorobenzotrifluoride Preparation Products And Raw materials |
|
