|
| | 1-(4-HYDROXYPHENYL)-2-THIOUREA Basic information |
| Product Name: | 1-(4-HYDROXYPHENYL)-2-THIOUREA | | Synonyms: | 4-HYDROXYPHENYLTHIOUREA;1-(4-HYDROXYPHENYL)-2-THIOUREA;4-HYDROXYPHENYLTHIOUREA, 98+%;USAF B-75;1-(p-hydroxyphenyl)-2-thio-ure;p-hydroxyphenylthiourea;1-(4-hydroxyphenyl)thiourea;N-(4-Hydroxyphenyl)thiourea | | CAS: | 1520-27-0 | | MF: | C7H8N2OS | | MW: | 168.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1520-27-0.mol |  |
| | 1-(4-HYDROXYPHENYL)-2-THIOUREA Chemical Properties |
| Melting point | 214 °C | | Boiling point | 341.5±44.0 °C(Predicted) | | density | 1.450±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.53±0.26(Predicted) | | BRN | 1102429 | | InChI | InChI=1S/C7H8N2OS/c8-7(11)9-5-1-3-6(10)4-2-5/h1-4,10H,(H3,8,9,11) | | InChIKey | QICKOOCQSYZYQB-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(O)C=C1)C(N)=S | | CAS DataBase Reference | 1520-27-0(CAS DataBase Reference) |
| Risk Statements | 22 | | Safety Statements | 22-36/37 | | RTECS | YT5250000 | | HazardClass | IRRITANT | | Toxicity | mouse,LD50,intraperitoneal,100mg/kg (100mg/kg),National Technical Information Service. Vol. AD277-689, |
| Provider | Language |
|
ALFA
| English |
| | 1-(4-HYDROXYPHENYL)-2-THIOUREA Usage And Synthesis |
| Uses | 1-(4-Hydroxyphenyl)thiourea is an intermediate in the synthesis of (SKI II), a nonlipid inhibitor of sphingosine kinase. SKI II s orally bioavailable and has shown significant inhibition of tumor growth in mice. |
| | 1-(4-HYDROXYPHENYL)-2-THIOUREA Preparation Products And Raw materials |
|
