|
| | Boldenone 17-acetate Basic information |
| Product Name: | Boldenone 17-acetate | | Synonyms: | 1,4-ANDROSTADIEN-17B-OL-3-ONEACETATE;1,4-ANDROSTADIEN-17-BETA-OL-3-ONE ACETATE;1,4-ANDROSTADIEN-17BETA-OL-3-ONE-17-ACETATE;(17beta)-hydroxyandrosta-1,4-dien-3-one acetate;DELTA-1-TESTOSTERONE ACETATE;BOLDENON 17-ACETATE;BOLDENONE 17-ACETATE;ANDROSTADIENOLONE ACETATE | | CAS: | 2363-59-9 | | MF: | C21H28O3 | | MW: | 328.45 | | EINECS: | 219-112-8 | | Product Categories: | API;boldenone;Steroids;Steroid and Hormone;2363-59-9 | | Mol File: | 2363-59-9.mol |  |
| | Boldenone 17-acetate Chemical Properties |
| Melting point | 149-151 °C | | Boiling point | 443.6±45.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | InChI | InChI=1/C21H28O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h8,10,12,16-19H,4-7,9,11H2,1-3H3/t16-,17-,18-,19-,20-,21-/s3 | | InChIKey | KPCDGGNHYODURF-CRZFGMLKNA-N | | SMILES | [C@]12([H])CC[C@]3(C)[C@H](CC[C@@]3([H])[C@]1([H])CCC1=CC(=O)C=C[C@]21C)OC(=O)C |&1:0,4,6,9,11,21,r| |
| | Boldenone 17-acetate Usage And Synthesis |
| Description | Boldenone 17-acetate is a white or white solid powder, belongs to the hormone class. | | Uses | The parent of 17-acetate bodanone is a derivative of testosterone and thus inherits most of its properties, such as androgenic ability and protein synthesis. |
| | Boldenone 17-acetate Preparation Products And Raw materials |
|
