|
| | 1,3-Dimethyladamantane Basic information |
| Product Name: | 1,3-Dimethyladamantane | | Synonyms: | Tricyclo[3.3.1.1(3,7)]decane, 1,3-dimethyl-;tricyclo[3.3.1.13,7]decane,1,3-dimethyl-;1,3-DIMETHYLADAMANTANE, 99+%;Memantine intermediate;1,3-Dimethyladamanta;1,3-diMethyl alkyl fund just;1,3-diMethyl adaMantanone;1,3-Dimethyladamantane,98% | | CAS: | 702-79-4 | | MF: | C12H20 | | MW: | 164.29 | | EINECS: | 211-870-8 | | Product Categories: | Chemical intermediate for Memantine HCl;Adamantane derivatives;Adamantanes;Alkanes;Cyclic;Organic Building Blocks;bc0001;702-79-4 | | Mol File: | 702-79-4.mol |  |
| | 1,3-Dimethyladamantane Chemical Properties |
| Melting point | -30 °C | | Boiling point | 201.5 °C | | density | 0.886 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.478(lit.) | | Fp | 127 °F | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | clear liquid | | color | Colorless to Almost colorless | | Specific Gravity | 0.886 | | Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. | | InChI | InChI=1S/C12H20/c1-11-4-9-3-10(5-11)7-12(2,6-9)8-11/h9-10H,3-8H2,1-2H3 | | InChIKey | CWNOIUTVJRWADX-UHFFFAOYSA-N | | SMILES | C12(C)CC3CC(CC(C)(C3)C1)C2 | | CAS DataBase Reference | 702-79-4(CAS DataBase Reference) | | NIST Chemistry Reference | Adamantane, 1,3-dimethyl-(702-79-4) |
| Hazard Codes | F | | Risk Statements | 10 | | Safety Statements | 16-60 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29021990 |
| | 1,3-Dimethyladamantane Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | 1,3-Dimethyladamantane is a dimethylated adamantane derivative. Memantine impurity A. Memantine Related Compound A (1,3-Dimethyladamantane). | | Application | 1,3-Dimethyladamantane was used in the synthesis of 1,3-dibromo-5,7-dimethyladamantane. | | Definition | ChEBI: 1,3-dimethyladamantane is a polycyclic alkane and a member of adamantanes. It derives from a hydride of an adamantane. | | General Description | 1,3-Dimethyladamantane undergoes C-H insertion reaction with phenylchlorocarbene. It reacts with with molecular oxygen in the presence of N-hydroxyphthalimide combined with cobalt salts to yield 3,5-dimethyladamantan-1-ol and 5,7-dimethyladamantane-1,3-diol. |
| | 1,3-Dimethyladamantane Preparation Products And Raw materials |
|
