|
| | 4-Methylphenylacetic acid Basic information |
| | 4-Methylphenylacetic acid Chemical Properties |
| Melting point | 88-92 °C (lit.) | | Boiling point | 265-267 °C (lit.) | | density | 1.0858 (rough estimate) | | refractive index | 1.5002 (estimate) | | Fp | 265-267°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | pka | pK1:4.370 (25°C) | | form | Fine Crystalline Powder | | color | White | | BRN | 2043528 | | InChI | InChI=1S/C9H10O2/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) | | InChIKey | GXXXUZIRGXYDFP-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(C)C=C1 | | CAS DataBase Reference | 622-47-9(CAS DataBase Reference) | | NIST Chemistry Reference | p-Tolylacetic acid(622-47-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | RTECS | AJ7569000 | | HazardClass | IRRITANT | | HS Code | 29163900 |
| | 4-Methylphenylacetic acid Usage And Synthesis |
| Chemical Properties | white fine crystalline powder | | Uses | p-Tolylacetic acid is a reagent used in the preparation of quaternary amines and epithelial sodium channel inhibition in bronchial epithelium. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 48, p. 1919, 1983 DOI: 10.1021/jo00159a031
Tetrahedron Letters, 28, p. 2633, 1987 DOI: 10.1016/S0040-4039(00)96167-7 | | Purification Methods | Crystallise the acid from heptane or water. [Beilstein 9 IV 1795.] |
| | 4-Methylphenylacetic acid Preparation Products And Raw materials |
|
