|
| | 6-(Trifluoromethyl)nicotinic acid Basic information |
| | 6-(Trifluoromethyl)nicotinic acid Chemical Properties |
| Melting point | 193-197 °C(lit.) | | Boiling point | 259.3±40.0 °C(Predicted) | | density | 1.484±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Acetonitrile (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.96±0.10(Predicted) | | color | Pale Beige to Light Brown | | InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)5-2-1-4(3-11-5)6(12)13/h1-3H,(H,12,13) | | InChIKey | JNYLMODTPLSLIF-UHFFFAOYSA-N | | SMILES | C1=NC(C(F)(F)F)=CC=C1C(O)=O | | CAS DataBase Reference | 231291-22-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | 6-(Trifluoromethyl)nicotinic acid Usage And Synthesis |
| Physical properties | 6-Trifluoromethylnicotinic acid is a white powder with a melting point
of 193-197 °C. It has a boiling point of 259.3℃ at 760 mmHg. Its
density is 1.484 g/cm3. Its flash point, refractive index and vapor
pressure are 110.6℃, 1.475 and 0.007mmHg at 25°C, respectively. | | Uses | 6-Trifluoromethyl Nicotinic Acid can be prepared to use Raf inhibitors to treat cancer. |
| | 6-(Trifluoromethyl)nicotinic acid Preparation Products And Raw materials |
|
