|
| | PHENYLGLYOXAL Basic information |
| Product Name: | PHENYLGLYOXAL | | Synonyms: | alpha-oxo-benzeneacetaldehyd;alpha-oxobenzeneacetaldehyde;Benzeneacetaldehyde, alpha-oxo-;Benzoylcarboxaldehyde;Benzoylformaldehyde;Glyoxal, phenyl-;Oxo(phenyl)acetaldehyde;Phenylethanedione | | CAS: | 1074-12-0 | | MF: | C8H6O2 | | MW: | 134.13 | | EINECS: | 214-036-1 | | Product Categories: | aldehyde | | Mol File: | 1074-12-0.mol |  |
| | PHENYLGLYOXAL Chemical Properties |
| Melting point | ~76 °C | | Boiling point | 142°C/125mmHg | | density | 1.133±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | BRN | 1854721 | | InChI | InChI=1S/C8H6O2/c9-6-8(10)7-4-2-1-3-5-7/h1-6H | | InChIKey | OJUGVDODNPJEEC-UHFFFAOYSA-N | | SMILES | C1(=CC=CC=C1)C(=O)C=O | | CAS DataBase Reference | 1074-12-0(CAS DataBase Reference) |
| | PHENYLGLYOXAL Usage And Synthesis |
| Chemical Properties | white to light yellow powder | | Definition | ChEBI: Phenylglyoxal is a member of phenylacetaldehydes. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 53, p. 830, 1988 DOI: 10.1021/jo00239a027
Tetrahedron Letters, 27, p. 5139, 1986 DOI: 10.1016/S0040-4039(00)85154-0 | | Enzyme inhibitor | This commercially available peptide/protein-modifying reagent (FW = 134.13 g/mol; CAS 1074-12-0), occasionally called benzoylformaldehyde, is a mild oxidant that reacts covalently with guanidinium groups at pH ~ 7, consuming two moles of reagent per mole of reactive arginyl residue. Modified guanidinium groups are relatively stable below pH 4; however, the original guanidinium group is slowly regenerated at neutral or alkaline pH. Upon prolonged incubation with phenylglyoxal, a-amino groups may also be modified. See also Glyoxal; 4-Hydroxyphenylglyoxal; etc. Target(s): To date, over 240 enzymes are inhibited by phenylglyoxal |
| | PHENYLGLYOXAL Preparation Products And Raw materials |
|
