|
| | Methyl 4,6-dichloropyridazine-3-carboxylate Basic information |
| Product Name: | Methyl 4,6-dichloropyridazine-3-carboxylate | | Synonyms: | METHYL 4,6-DICHLOROPYRIDAZINE-3-CARBOXYLATE;4,6-Dichloro-4-(methoxycarbonyl)pyridazine;6-dichloro-pyridazine-3-carboxylic acid methyl ester;3-Methoxycarbonyl-4,6-dichloropyridazine;4,6-Dichloro-pyridazine-3-carboxylic acid Methyl ester;METHYL 4,6-DICHLOROPYRIDAZINE-3-CARBOXYLAT;3-Pyridazinecarboxylic acid, 4,6-dichloro-, methyl ester;METHYL 4,6-DICHLOROPYRIDAZINE-3-CARBOXYLATE ISO 9001：2015 REACH | | CAS: | 372118-01-9 | | MF: | C6H4Cl2N2O2 | | MW: | 207.01 | | EINECS: | | | Product Categories: | 1;372118-01-9 | | Mol File: | 372118-01-9.mol |  |
| | Methyl 4,6-dichloropyridazine-3-carboxylate Chemical Properties |
| Boiling point | 345.2±37.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Very Slightly) | | pka | -2.30±0.10(Predicted) | | form | powder | | color | Light beige/light brown crystalline | | InChI | InChI=1S/C6H4Cl2N2O2/c1-12-6(11)5-3(7)2-4(8)9-10-5/h2H,1H3 | | InChIKey | MZEVRGMQXLNKEZ-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NN=C(Cl)C=C1Cl |
| | Methyl 4,6-dichloropyridazine-3-carboxylate Usage And Synthesis |
| | Methyl 4,6-dichloropyridazine-3-carboxylate Preparation Products And Raw materials |
|
