|
| | DBE DIBASIC ESTER Basic information |
| | DBE DIBASIC ESTER Chemical Properties |
| Melting point | -20°C | | Boiling point | 196-225 °C(lit.) | | density | 1.19 g/mL at 25 °C(lit.) | | vapor pressure | 0.2 mm Hg ( 20 °C) | | refractive index | n20/D 1.424(lit.) | | Fp | 212 °F | | storage temp. | Store below +30°C. | | explosive limit | 8% | | InChI | InChI=1S/C8H14O4.C7H12O4.C6H10O4/c1-11-7(9)5-3-4-6-8(10)12-2;1-10-6(8)4-3-5-7(9)11-2;1-9-5(7)3-4-6(8)10-2/h3-6H2,1-2H3;3-5H2,1-2H3;3-4H2,1-2H3 | | InChIKey | QYMFNZIUDRQRSA-UHFFFAOYSA-N | | SMILES | C(=O)(OC)CCC(=O)OC.C(C(=O)OC)CCCC(=O)OC.C(C(=O)OC)CCC(=O)OC | | EPA Substance Registry System | Hexanedioic acid, dimethyl ester, mixt. with dimethyl butanedioate and dimethyl pentanedioate (95481-62-2) |
| | DBE DIBASIC ESTER Usage And Synthesis |
| Chemical Properties | Dibasic ester is an ester of a dicarboxylic acid. Non-flammable, non-corrosive, and quickly biodegrading – all factors leading to an environmentally-friendly product. Easily soluble in alcohol and only slightly soluble in water, it is colorless, clear and has a slightly fruity odor. | | Uses | Dibasic ester was commonly used as lubricants, solvents, plasticizers, additives, and spin finishes. It acts as a coating agent for magnet and enamel wires, magnetic memory discs, automobiles, coils, cans, sheets, industrial paint, et cetera. |
| | DBE DIBASIC ESTER Preparation Products And Raw materials |
|
