|
| | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane Basic information |
| Product Name: | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane | | Synonyms: | PERFLUOROALKYLTRIETHOXYSILANE;TRIETHOXY-1H,1H,2H,2H-PERFLUORODECYLSILANE;1H,1H,2H,2H-PERFLUORODECYLTRIETHOXYSILANE;(HEPTADECAFLUORO-1,1,2,2-TETRAHYDRODECYL)TRIETHOXYSILANE;(HEPTADECAFLUORO-1,1,2,2-TETRAHYDRODECYL)-1-TRIETHOXYSILANE;1H,1H,2H,2H-Perfluorodecyltriethoxysilane 97%;1H,1H,2H,2H-Perfluorodecyltriethoxysilane97%;(Heptadecafluoro-1,1,2,2-tetrahydrodecyl)triethoxysilane? Perfluorodecyltriethoxysilane | | CAS: | 101947-16-4 | | MF: | C16H19F17O3Si | | MW: | 610.38 | | EINECS: | 000-000-0 | | Product Categories: | silicone additives | | Mol File: | 101947-16-4.mol |  |
| | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane Chemical Properties |
| Boiling point | 209-230 °C | | density | 1.389 g/mL at 25 °C | | refractive index | n20/D 1.342 | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Miscible with ethanol and tetrahydrofuran. | | form | liquid | | Specific Gravity | 1.41 | | color | Colourless | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C16H19F17O3Si/c1-4-34-37(35-5-2,36-6-3)8-7-9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h4-8H2,1-3H3 | | InChIKey | MLXDKRSDUJLNAB-UHFFFAOYSA-N | | SMILES | [Si](OCC)(OCC)(OCC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 101947-16-4(CAS DataBase Reference) | | EPA Substance Registry System | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane (101947-16-4) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1760 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Corrosive | | TSCA | No | | HazardClass | 8 | | HS Code | 29319090 |
| | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane Usage And Synthesis |
| Description | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane, also named perfluoroalkylethyltrimethoxysilane (PFATES), is used to bond poly(tetrafluoroethylene) films to silicon wafers and it is also utilized in anti-reflective coating, release coating and soil repellent coating because of its special chemical structure. It can be used as an anti-fingerprint agent for glass products such as advanced mobile phone screens and camera lenses. | | Chemical Properties | Colorless liquid | | Uses | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane is used in making thin film transistors, polyethersulfone membranes, and a superwettable Janus membrane. | | Application | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane(PFDTES) was used to functionalize hydrophobic ceramic membranes with nanosized pores. It was also used to functionalize Cu2(OH)3NO3 crystal to render it hydrophobic. The product may be used to coat nanosized medical devices.
PFDTES is used for the superhydrophobicity of polyvinylidene fluoride(PVDF) to protect the metal surfaces from fouling. A cost effective and scalable superamphiphobic spray coating of PFDTES on stainless steel surfaces may potentially be used to create anti-icing and stain-resistant surfaces. It may be used to modify the surface of poly(methyl methacrylate(PMMA) for the fabrication of microfluidic chips. | | General Description | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane(PFDTES) is a fluoroalkylsilanes(FAS) with low surface energy and high wettability due to the presence of fluorinated carbons. It is used as a superhydrophobic agent for synthesizing various functional coatings. |
| | 1H,1H,2H,2H-Perfluorodecyltriethoxysilane Preparation Products And Raw materials |
|
