|
| | 3,6-DIFLUOROPHTHALIC ANHYDRIDE Basic information |
| Product Name: | 3,6-DIFLUOROPHTHALIC ANHYDRIDE | | Synonyms: | 3,6-DIFLUOROPHTHALIC ANHYDRIDE;1,3-Isobenzofurandione, 4,7-difluoro-;4,7-Difluoro-1,3-isobenzofurandione;3,6-Difluorophthalic anhydride,99%;5,8-Difluoro-1,3-Isobenzofurandione;4,7-difluoroisobenzofuran-1,3-dione;4,7-difluoro-1,3-dihydro-2-benzofuran-1,3-dione;3,6-Difluorophthalic anhydride, 97%, 97% | | CAS: | 652-40-4 | | MF: | C8H2F2O3 | | MW: | 184.1 | | EINECS: | 620-755-5 | | Product Categories: | Phthalic Acids, Esters and Derivatives;Anhydride Monomers;Monomers;Polymer Science | | Mol File: | 652-40-4.mol |  |
| | 3,6-DIFLUOROPHTHALIC ANHYDRIDE Chemical Properties |
| Melting point | 218-221 °C (lit.) | | Boiling point | 315.7±32.0 °C(Predicted) | | density | 1.658 | | storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere | | solubility | Acetonitrile, DMSO | | form | Solid | | color | White | | Sensitive | Moisture Sensitive | | Stability: | moisture sensitive | | InChI | InChI=1S/C8H2F2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H | | InChIKey | AVLRPSLTCCWJKC-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(F)=CC=C2F)C(=O)O1 | | CAS DataBase Reference | 652-40-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29173990 |
| | 3,6-DIFLUOROPHTHALIC ANHYDRIDE Usage And Synthesis |
| Chemical Properties | white to off-white powder | | Uses | 4,7-Difluoro-1,3-isobenzofurandione is used in the synthesis of phthalic compounds, phthalazines, and quinones with antimicrobial activity. |
| | 3,6-DIFLUOROPHTHALIC ANHYDRIDE Preparation Products And Raw materials |
|
