|
| | 4,6-Dichloro-5-methoxypyrimidine Basic information |
| Product Name: | 4,6-Dichloro-5-methoxypyrimidine | | Synonyms: | 2,4-dimethoxy-2-methylmercapyrimidine;4,6-Dichlor-5-methoxypyrimidin;4,6-DICHLORO-5-METHOXYPYRIMIDINE;4,6-DICHLORO-5-METHOXYPYRIMIDINE 99%;Pyrimidine, 4,6-dichloro-5-methoxy-;2,4-Dichloro-5-MetoxyPyriMidine;5-Methoxy-4,6-dichloropyriMidine;4,6-Dichloro-5-methoxy-1,3-diazine | | CAS: | 5018-38-2 | | MF: | C5H4Cl2N2O | | MW: | 179 | | EINECS: | 225-699-1 | | Product Categories: | Heterocycle-Pyrimidine series;Halides;Pyrimidine series;APIs & Intermediate;Pyrimidine Derivertives;Pyrazines, Pyrimidines & Pyridazines;Pyrimidine | | Mol File: | 5018-38-2.mol |  |
| | 4,6-Dichloro-5-methoxypyrimidine Chemical Properties |
| Melting point | 54-58 °C | | Boiling point | 257.8±35.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Dichloromethane (Slightly) | | form | Solid | | pka | -4.13±0.26(Predicted) | | color | White | | InChI | InChI=1S/C5H4Cl2N2O/c1-10-3-4(6)8-2-9-5(3)7/h2H,1H3 | | InChIKey | IJQIGKLDBGKSNT-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C(OC)C(Cl)=N1 | | CAS DataBase Reference | 5018-38-2(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HS Code | 2933599590 |
| | 4,6-Dichloro-5-methoxypyrimidine Usage And Synthesis |
| Chemical Properties | Off-white solid | | Uses | 4,6-Dichloro-5-methoxypyrimidine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | 4,6-Dichloro-5-methoxypyrimidine Preparation Products And Raw materials |
|
