|
| | IODOPENTAFLUOROBENZENE Basic information |
| Product Name: | IODOPENTAFLUOROBENZENE | | Synonyms: | Pentafluoroiodobenzene (stabilized with Copper chip);Iodoperfluorobenzene 99%;2,3,4,5,6-Pentafluoro-1-iodobenzene;Five-fluoroiodobenzene;Iodopentafluorobenzene, 99%, stabilised over copper;Pentafluoroiodobenzene, 1-Iodo-2,3,4,5,6-pentafluorobenzene, Perfluoroiodobenzene;Iodopentafluorobenzene, stabilized with copper;Iodopentafluorobenzene SynonyMs: Pentafluoroiodobenzene | | CAS: | 827-15-6 | | MF: | C6F5I | | MW: | 293.96 | | EINECS: | 212-565-2 | | Product Categories: | organofluorine compounds;Aryl;C6;Halogenated Hydrocarbons | | Mol File: | 827-15-6.mol |  |
| | IODOPENTAFLUOROBENZENE Chemical Properties |
| Melting point | -29°C | | Boiling point | 161 °C(lit.) | | density | 2.204 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.496(lit.) | | Fp | None | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Liquid | | color | Clear colorless | | Specific Gravity | 2.204 | | Water Solubility | Insoluble in water. | | Sensitive | Light Sensitive | | BRN | 2051549 | | Exposure limits | ACGIH: TWA 0.2 mg/m3; TWA 1 mg/m3
OSHA: TWA 0.1 mg/m3; TWA 1 mg/m3
NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3; TWA 0.1 mg/m3 | | InChI | InChI=1S/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 | | InChIKey | OPYHNLNYCRZOGY-UHFFFAOYSA-N | | SMILES | C1(F)=C(I)C(F)=C(F)C(F)=C1F | | CAS DataBase Reference | 827-15-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 |
| | IODOPENTAFLUOROBENZENE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Iodopentafluorobenzene was used to study the formation of radical ions of iodopentafluorobenzene in aqueous solution . It was used as solvent in a study to determine singlet oxgen lifetimes from phosphorescence decays in halogen substituted perfluorinated solvents by infrared emission spectrometery . It has potential applications in plasma processing industry and in preparation of catalysts . | | Uses | - Iodopentafluorobenzene was used to study the formation of radical ions of iodopentafluorobenzene in aqueous solution.
- It was used as solvent in a study to determine singlet oxgen lifetimes from phosphorescence decays in halogen substituted perfluorinated solvents by infrared emission spectrometery.
- It has potential applications in plasma processing industry and in preparation of catalysts.
| | General Description | Iodopentafluorobenzene forms supramolecular complexes with aromatic electron donors by forming halogen bonds to form discrete heterodimeric aggregates. |
| | IODOPENTAFLUOROBENZENE Preparation Products And Raw materials |
| Raw materials | Benzene, 1,2,3,4,5-pentafluoro-6-(2-iodo-4,6-dinitrophenoxy)- | | Preparation Products | [BIS(TRIFLUOROACETOXY)IODO]PENTAFLUOROBENZENE-->2,3,4,5,6-Pentafluoroaniline-->Decafluorobiphenyl-->Pentafluorobenzonitrile-->2,3,4,5,6-PENTAFLUOROBIPHENYL-->DI-N-BUTYL SULFOXIDE-->2,3,4,5,6-PENTAFLUOROPHENYLACETONITRILE-->PHENYL TRIFLUOROACETATE-->Pentafluorobenzyl chloride-->2,3,4,5,6-PENTAFLUOROSTYRENE-->Chloropentafluorobenzene-->ISOPROPYL TRIFLUOROACETATE-->2,3,4,5,6-PENTAFLUOROBENZHYDROL-->hexafluorobenzene |
|
