|
| | Polyglutamic acid Basic information |
| | Polyglutamic acid Chemical Properties |
| storage temp. | −20°C | | InChI | InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/s3 | | InChIKey | WHUUTDBJXJRKMK-ZJPLZJKBNA-N | | SMILES | [C@@H](N)(C(=O)O)CCC(=O)O |&1:0,r| |
| WGK Germany | 3 | | RTECS | MA1700000 | | F | 3-10 |
| | Polyglutamic acid Usage And Synthesis |
| Description | Polyglutamic acid (PGA), a poly amino acid produced by Bacillus spp. is a naturally occurring anionic, water-soluble, biodegradable, non-toxic, viscous, edible biopolymer containing D and L-glutamic acid residues with different industrial applications. | | Application | Polyglutamic acid is considered a promising bio-based chemical and is already widely used in the food, medical, and wastewater industries due to its biodegradable, non-toxic, and non-immunogenic properties. | | Preparation | The Preparation method of Polyglutamic acid is as follows：poplar sawdust was used to produce Polyglutamic acid. Poplar sawdust was treated with acid and then hydrolyzed with cellulose. The enzymatic hydrolysate was used to produce Polyglutamic acid. Through single factor and orthogonal experiments, the optimum enzymatic conditions were determined as follows: solid-liquid ratio 1:5, enzyme amount 22 FPU/g, pH 5.0 and 53 min. Under the enzymatic hydrolysate medium, the Polyglutamic acid yield reached 30.87 ± 0.44 g/L, which was 5.11% higher than that in glucose medium (29.37 ± 0.43 g/L). In addition, the amount of glucose added to the medium was reduced, which realized the comprehensive utilization of various sugars in sawdust enzymatic hydrolysate. | | Definition | ChEBI: A macromolecule composed of repeating gamma-linked L-glutamyl units. |
| | Polyglutamic acid Preparation Products And Raw materials |
|
