|
| | 9,9-Bis(3,4-dicarboxyphenyl)fluorene Dianhydride Basic information |
| Product Name: | 9,9-Bis(3,4-dicarboxyphenyl)fluorene Dianhydride | | Synonyms: | 1,3-Isobenzofurandione, 5,5'-(9H-fluoren-9-ylidene)bis-;9,9-Bis(3,4-dicarboxyphenyl)fluorene Dianhydride;5,5'-(9H-fluorene-9,9-diyl)bis(isobenzofuran-1,3-dione);9,9-Bis(3,4-dicarboxyphenyl) fluorine Dianhydride (BPAF);5-[9-(1,3-dioxo-2-benzofuran-5-yl)fluoren-9-yl]-2-benzofuran-1,3-dione;9,9-Bis(3,4-dicarboxyphenyl)fluorene Dianhydride (BPAF);1,3-Isobenzofurandione, 5,5;5,5'-(9H-Fluorene-9,9-diyl)bis(2-benzofuran-1,3-dione) | | CAS: | 135876-30-1 | | MF: | C29H14O6 | | MW: | 458.42 | | EINECS: | | | Product Categories: | | | Mol File: | 135876-30-1.mol |  |
| | 9,9-Bis(3,4-dicarboxyphenyl)fluorene Dianhydride Chemical Properties |
| Melting point | 269 °C | | Boiling point | 687.9±55.0 °C(Predicted) | | density | 1.521±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C29H14O6/c30-25-19-11-9-15(13-21(19)27(32)34-25)29(16-10-12-20-22(14-16)28(33)35-26(20)31)23-7-3-1-5-17(23)18-6-2-4-8-24(18)29/h1-14H | | InChIKey | FMACFWAQBPYRFO-UHFFFAOYSA-N | | SMILES | C1(C2C=CC3C(=O)OC(=O)C=3C=2)(C2C=CC3C(=O)OC(=O)C=3C=2)C2=C(C=CC=C2)C2=C1C=CC=C2 | | CAS DataBase Reference | 135876-30-1 |
| | 9,9-Bis(3,4-dicarboxyphenyl)fluorene Dianhydride Usage And Synthesis |
| Chemical Properties | white to almost white powder to crystal | | Uses | Used in Polyimide Monomer |
| | 9,9-Bis(3,4-dicarboxyphenyl)fluorene Dianhydride Preparation Products And Raw materials |
|
