|
| | Ethopabate Basic information |
| | Ethopabate Chemical Properties |
| Melting point | 148-151 °C | | Boiling point | 426.1±35.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO: 50 mg/mL (210.75 mM) | | pka | 14.12±0.70(Predicted) | | form | A solid | | Merck | 13,3781 | | InChI | InChI=1S/C12H15NO4/c1-4-17-11-7-9(13-8(2)14)5-6-10(11)12(15)16-3/h5-7H,4H2,1-3H3,(H,13,14) | | InChIKey | GOVWOKSKFSBNGD-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=C(NC(C)=O)C=C1OCC | | CAS DataBase Reference | 59-06-3(CAS DataBase Reference) | | EPA Substance Registry System | Ethopabate (59-06-3) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2924296000 |
| | Ethopabate Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | A supplementary drug that improves the coccidiostatic effect of nicarbazin and amprolium in order to cure coccidiosis in chickens. | | Uses | antidepressant | | Definition | ChEBI: Ethopabate is an amidobenzoic acid. | | Clinical Use | Ethopabate is only a narrow anticoccidial spectrum drug against Eimeria acervulina. It has no or only slight activity against E. maxima, E. necatrix, E. tenella or E. brunetti. Today, ethopabate is applied only in combination with amprolium and sulfonamide. | | Molecular Interactions | Ethopabate is a 2-substituted PABA derivative (=4-acetamido-2-ethoxybenzoic acid methylester) and functions as a prodrug. Its activity becomes potentiated by pyrimethamine and antagonised by the simultaneous administration of PABA. Thus, the mode of action of ethopabate is similar to that of sulfonamides or sulfones. |
| | Ethopabate Preparation Products And Raw materials |
|
