|
| | 2,7-Diaminofluorene Basic information |
| | 2,7-Diaminofluorene Chemical Properties |
| Melting point | 160-162 °C (lit.) | | Boiling point | 323.14°C (rough estimate) | | density | 1.1265 (rough estimate) | | refractive index | 1.5014 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.63±0.20(Predicted) | | form | powder to crystaline | | color | White to Gray to Brown | | Water Solubility | Slightly soluble in cold water. Soluble in hot water. Sparingly soluble in ethanol. and acetone. Insoluble in ether. | | Merck | 14,4156 | | BRN | 2099859 | | InChI | InChI=1S/C13H12N2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5,14-15H2 | | InChIKey | SNCJAJRILVFXAE-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2 | | CAS DataBase Reference | 525-64-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | LL6980000 | | HS Code | 2921.51.5000 |
| | 2,7-Diaminofluorene Usage And Synthesis |
| Uses | 2,7-Diaminofluorene is used to make polyamide resin composites and polyamide films. | | Purification Methods | Crystallise the diamine from hot H2O or aqueous EtOH, dry it in vacuo and store it in the dark. [Beilstein 13 H 266, 13 II 123, 12 III 507, 13 IV 449.] |
| | 2,7-Diaminofluorene Preparation Products And Raw materials |
|
