|
| | (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol Basic information |
| Product Name: | (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol | | Synonyms: | BenzeneMethanol,2,6-dichloro-3-fluoro-a-Methyl-, (aS)-;(1S)-1-(2,6-dichloro-3-fluorophenyl)ethan-1-ol;(S)-1-(2,6-dichloro-4-fluorophenyl)ethanol;(1S)-1-(2,6-Dichloro-3-fluorophenyl)ethane-1-ol;(aS)-2,6-Dichloro-3-fluoro-a-methyl-benzenemethanol;-1-(2,6-Dichloro-3-fluorophenyl);(S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol;(S)-1-(2,6-dichloro-3-fluorophenyl)ethan-1-ol | | CAS: | 877397-65-4 | | MF: | C8H7Cl2FO | | MW: | 209.04 | | EINECS: | 700-699-9 | | Product Categories: | Aromatic Ring;Chiral Compounds | | Mol File: | 877397-65-4.mol |  |
| | (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol Chemical Properties |
| Boiling point | 261.3±35.0 °C(Predicted) | | density | 1.406±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 13.30±0.20(Predicted) | | color | White | | InChI | InChI=1/C8H7Cl2FO/c1-4(12)7-5(9)2-3-6(11)8(7)10/h2-4,12H,1H3/t4-/s3 | | InChIKey | JAOYKRSASYNDGH-UFLUHPNLNA-N | | SMILES | [C@H](C1C(=CC=C(F)C=1Cl)Cl)(O)C |&1:0,r| | | CAS DataBase Reference | 877397-65-4 |
| HazardClass | IRRITANT | | HS Code | 2906290090 |
| | (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol Usage And Synthesis |
| Uses | (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol is an intermediate in the synthetic preparation of Crizotinib (C785000), a potent and selective dual inhibitor of mesenchymal-epithelial transition factor (
c-MET) kinase and anaplastic lymphoma kinase (ALK). Crizotinib is a potential antitumor agent. | | Uses | (S) -1- (2,6-dichloro-3-fluorophenyl) ethanol(C8H7C12FO) is synthesized (R)-3-[l-(2, 6-dichloro-3-fluoro-benzene)- The key intermediate of ethoxy-5- (l-piperidine-4-hydroxy-1 hydrogen-pyrazole-4-hydroxy) -pyrimidine-2-indane. And (R)-3-[l-(2,6-dichloro-3-fluoro-benzene)-ethoxy-5-(l-piperidine-4-hydroxy-1 hydrogen-pyrazole-4-hydroxy) -Pyrimidine-2-indane is a small molecule kinase inhibitor for the treatment of locally advanced or metastatic non-small cell lung cancer (NSCLC) positive for anaplastic lymphohematokinase (ALK). | | Uses | (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol is an intermediate in the synthetic preparation of Crizotinib (C785000), a potent and selective dual inhibitor of mesenchymal-epithelial transition factor (c-MET) kinase and anaplastic lymphoma kinase (ALK). Crizotinib is a potential antitumor agent. |
| | (S)-1-(2,6-Dichloro-3-fluorophenyl)ethanol Preparation Products And Raw materials |
|
