|
| | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Basic information |
| Product Name: | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide | | Synonyms: | PHENYLBIS(2,4,6-TRIMETHYLBENZOYL)PHOSPHINE OXIDE;Phosphine oxide, phenylbis(2,4,6-trimethylbenzoyl)-;Phenylbis(2,4,6-triMethylbenzoyl)phosphine oxide 97%, powder;former IRGACURE 819;IRGACURE(R) 819;Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide ,99%;Photoinitiator XBPO;HRcure-819 | | CAS: | 162881-26-7 | | MF: | C26H27O3P | | MW: | 418.47 | | EINECS: | 423-340-5 | | Product Categories: | Miscellaneous;Organic Photoinitiators;Polymerization Initiators | | Mol File: | 162881-26-7.mol |  |
| | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Chemical Properties |
| Melting point | 131-135 °C(lit.) | | Boiling point | 590.0±60.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | acetone, acetonitrile, toluene, and hexanedioldiacrylate: soluble | | form | powder | | color | Pale Yellow to Yellow | | Water Solubility | 100μg/L at 20-21℃ | | λmax | 366nm(MeOH)(lit.) | | InChI | InChI=1S/C26H27O3P/c1-16-12-18(3)23(19(4)13-16)25(27)30(29,22-10-8-7-9-11-22)26(28)24-20(5)14-17(2)15-21(24)6/h7-15H,1-6H3 | | InChIKey | GUCYFKSBFREPBC-UHFFFAOYSA-N | | SMILES | P(C1C=CC=CC=1)(=O)(C(C1C(=CC(C)=CC=1C)C)=O)C(C1C(=CC(C)=CC=1C)C)=O | | LogP | 5.77-5.8 at 22℃ | | CAS DataBase Reference | 162881-26-7 | | EPA Substance Registry System | Phosphine oxide, phenylbis(2,4,6-trimethylbenzoyl)- (162881-26-7) |
| Hazard Codes | Xi | | Risk Statements | 43-53 | | Safety Statements | 22-24-37-61 | | WGK Germany | - | | HS Code | 29319090 |
| | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Usage And Synthesis |
| Uses | 3-Bromo-1-(3-chloro-2-pyridinyl)-1H-pyrazole-5-carboxylic acid is a useful building block and has been used in the synthesis of the pesticide Cyclaniliprole. | | Uses | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide is a useful research chemical compound. | | Uses | Versatile UV photoinitiator for radical polymerization of unsaturated resins, especially pigmented formulations. |
| | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide Preparation Products And Raw materials |
|
