|
| | 4-Amino-3,5-dichloro-alpha-bromoacetophenone Basic information | | Uses |
| | 4-Amino-3,5-dichloro-alpha-bromoacetophenone Chemical Properties |
| Melting point | 142-1450C | | Boiling point | 396.4±42.0 °C(Predicted) | | density | 1.764±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | -2.21±0.10(Predicted) | | color | Off-White to Yellow | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C8H6BrCl2NO/c9-3-7(13)4-1-5(10)8(12)6(11)2-4/h1-2H,3,12H2 | | InChIKey | ATKJJUFAWYSFID-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(Cl)=C(N)C(Cl)=C1)CBr | | CAS DataBase Reference | 37148-47-3 |
| | 4-Amino-3,5-dichloro-alpha-bromoacetophenone Usage And Synthesis |
| Uses | 4-Amino-3,5-dichlorophenacylbromide is a compound useful in organic synthesis. | | Chemical Properties | Yellow Solid | | Uses | 1-(4-Amino-3,5-dichlorophenyl)-2-bromoethanone Hydrobromide is an intermediate in synthesizing Clenproperol-d7 (C573002). A labelled related drug of Clenbuterol (C569998), a β-agonist which can be used as a growth promoter in farm animals. | | Preparation | Dissolve 4-amino-3, 5-dichloroacetophenone in chloroform and heat to
65°C. Add bromine dropwise with stirring, stir for a few minutes after
adding, then add ethanol and stir. Freeze, filter out the crystals, wash with chloroform, and dry at low temperature to obtain finished
products. |
| | 4-Amino-3,5-dichloro-alpha-bromoacetophenone Preparation Products And Raw materials |
|
