|
| | RG7227, ITMN-191, RO5190591 Basic information |
| Product Name: | RG7227, ITMN-191, RO5190591 | | Synonyms: | RG7227, ITMN-191, RO5190591;4-Fluoro-1,3-dihydro-2H-isoindole-2-carboxylic acid (2R,6S,13aS,14aR,16aS)-14a-[[(cyclopropylsulfonyl)amino]carbonyl]-6-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,5,6,7,8,9,10,11,13a,14,14a,15,16,16a-hexadecahydro-5,16-dioxocyclopropa[e]pyrrolo[1,2-a][1,4]diazacyclopentadecin-2-yl ester;Danoprevir;ITMN-191;Danoprevir(ITMN-191);Danoprevir - ITMN 191 | RG 7227 | R 7227;2H-Isoindole-2-carboxylic acid, 4-fluoro-1,3-dihydro-, (2R,6S,13aS,14aR,16aS)-14a-[[(cyclopropylsulfonyl)amino]carbonyl]-6-[[(1,1-dimethylethoxy)carbonyl]amino]-1,2,3,5,6,7,8,9,10,11,13a,14,14a,15,16,16a-hexadecahydro-5,16-dio;CS-64 | | CAS: | 850876-88-9 | | MF: | C35H46FN5O9S | | MW: | 731.83 | | EINECS: | | | Product Categories: | Inhibitor;Inhibitors | | Mol File: | 850876-88-9.mol |  |
| | RG7227, ITMN-191, RO5190591 Chemical Properties |
| Melting point | >165°C (dec.) | | density | 1.41 | | storage temp. | -20°C Freezer | | solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.43±0.60(Predicted) | | color | White to Pale Beige | | InChIKey | ZVTDLPBHTSMEJZ-AIYSODCISA-N | | SMILES | C1C2=C(C(F)=CC=C2)CN1C(O[C@H]1CN2C(=O)[C@@H](NC(OC(C)(C)C)=O)CCCCCC=C[C@]3([H])C[C@@]3(C(NS(C3CC3)(=O)=O)=O)NC(=O)[C@]2([H])C1)=O |t:33| |
| | RG7227, ITMN-191, RO5190591 Usage And Synthesis |
| Description | Danoprevir is an orally bioavailable inhibitor of hepatitis C virus (HCV) nonstructural protein 3/4A (NS3/4A; IC50 = 1 nM), a serine protease essential for HCV replication. It is selective for NS3/4A over a panel of 53 proteases at a concentration of 10 μM. Danoprevir inhibits replication of the HCV genotypes 1a, 1b, 4, 5, and 6 (IC50s = 0.2-0.4 nM) as well as 2b and 3a (IC50s = 1.6 and 3.5 nM, respectively) in vitro. It also reduces the number of HCV genotype 1b replicons in Huh-7 cells (EC50 = 1.8 nM). | | Uses | Danoprevir is a selective and potent inhibitor of Hepatitis C virus. | | target | HCV NS3/4A protease |
| | RG7227, ITMN-191, RO5190591 Preparation Products And Raw materials |
|
