|
| | Dibenzothiophene-2-boronic acid Basic information |
| Product Name: | Dibenzothiophene-2-boronic acid | | Synonyms: | Dibenzo[b,d]thiophen-2-ylboronic acid , May contain varying amounts of anhydride, 97%;dibenzo[b,d]thien-2-ylboronic acid(SALTDATA: FREE);Dibenzothiophene-2-Boronic;Dibenzo[b,d]thiophen-2-ylboronic acid, 95%, May contain varying aMounts of anhydride;(Dibenzothiophen-2-yl)boronic acid;2-Dibenzothienylboronic acid;DIBENZO[B,D]THIEN-2-YLBORONIC ACID;DIBENZO[B,D]THIOPHEN-2-YLBORONIC ACID | | CAS: | 668983-97-9 | | MF: | C12H9BO2S | | MW: | 228.08 | | EINECS: | 688-282-7 | | Product Categories: | | | Mol File: | 668983-97-9.mol |  |
| | Dibenzothiophene-2-boronic acid Chemical Properties |
| Boiling point | 480℃ | | density | 1.38 | | Fp | 244℃ | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.39±0.30(Predicted) | | color | White | | InChI | InChI=1S/C12H9BO2S/c14-13(15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-7,14-15H | | InChIKey | CSLSCVHILGCSTE-UHFFFAOYSA-N | | SMILES | B(C1=CC=C2SC3=CC=CC=C3C2=C1)(O)O | | CAS DataBase Reference | 668983-97-9 |
| Hazard Codes | Xn | | Risk Statements | 22 | | HS Code | 29349990 |
| | Dibenzothiophene-2-boronic acid Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | Dibenzothiophene-2-boronic acid is a useful reagent in chemical processes and organic synthesis. It has various applications, including in the production of organic semiconductors like thiophene-based polymers and oligomers. Furthermore, it can be used as a building block in the synthesis of various fluorescent dyes, such as BODIPY and rhodamine derivatives. | | Synthesis | Dibenzothiophene-2-boronic acid is prepared by reacting 2-Bromodibenzo[b,d]thiophene with Trimethyl borate in prestence of n-BuLi.
 |
| | Dibenzothiophene-2-boronic acid Preparation Products And Raw materials |
|
