|
| 1,6-Bis(diphenylphosphino)hexane Basic information |
| 1,6-Bis(diphenylphosphino)hexane Chemical Properties |
Melting point | 124-126 °C(lit.) | Boiling point | 564.0±33.0 °C(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | form | powder to crystal | color | White to Almost white | InChI | InChI=1S/C30H32P2/c1(15-25-31(27-17-7-3-8-18-27)28-19-9-4-10-20-28)2-16-26-32(29-21-11-5-12-22-29)30-23-13-6-14-24-30/h3-14,17-24H,1-2,15-16,25-26H2 | InChIKey | GPORFKPYXATYNX-UHFFFAOYSA-N | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)CCCCCCP(C1C=CC=CC=1)C1C=CC=CC=1 | CAS DataBase Reference | 19845-69-3(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-37/39 | WGK Germany | 3 | HS Code | 29319090 |
| 1,6-Bis(diphenylphosphino)hexane Usage And Synthesis |
| 1,6-Bis(diphenylphosphino)hexane Preparation Products And Raw materials |
|