|
| | DI-O-TOLYLCHLOROPHOSPHINE Basic information |
| Product Name: | DI-O-TOLYLCHLOROPHOSPHINE | | Synonyms: | Bis(2-methylphenyl)phosphinous chloride, Chlorobis(2-methylphenyl)phosphine;Di-o-tolylchlorophosphine, min. 98%;Chlorobis(o-tolyl)phosphine;Di(o-methylphenyl)phosphine chloride;BIS(O-TOLYL)CHLOROPHOSPHINE;BIS(2-METHYLPHENYL)PHOSPHINOUS CHLORIDE;DI(2-TOLYL)CHLOROPHOSPHINE;DI-O-TOLYLCHLOROPHOSPHINE | | CAS: | 36042-94-1 | | MF: | C14H14ClP | | MW: | 248.69 | | EINECS: | | | Product Categories: | organophosphine halide | | Mol File: | 36042-94-1.mol |  |
| | DI-O-TOLYLCHLOROPHOSPHINE Chemical Properties |
| Melting point | 57°C | | Boiling point | 174-178°C/3mm | | Fp | 174-178°C/3mm | | storage temp. | 2-8°C | | form | liquid | | color | white to yellow | | Water Solubility | Not miscible or difficult to mix in water. | | Sensitive | Moisture Sensitive |
| Hazard Codes | F,C | | Risk Statements | 17-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2845 4.2/PG 1 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | II |
| | DI-O-TOLYLCHLOROPHOSPHINE Usage And Synthesis |
| Uses | Chlorodi(o-tolyl)phosphine is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dye stuff. | | Purification Methods | It is purified by fractional distillation in a vacuum (b 179-183o/7mm, 253-257o/15mm,) and the distillate solidifies (m 36o, also reported is m 37o). [Weinberg J Org chem. 40 3586 1975, McEwen et al. J Am Chem Soc 100 7304 1978, Beilstein 16 H 769, 16 IV 970 for chlorodi(p-tolyl)phosphine.] |
| | DI-O-TOLYLCHLOROPHOSPHINE Preparation Products And Raw materials |
|
