|
| 3-Des(1-ethylpropoxy)-3-(1-Methylpropoxy) OseltaMivir Basic information |
| 3-Des(1-ethylpropoxy)-3-(1-Methylpropoxy) OseltaMivir Chemical Properties |
Boiling point | 462.1±45.0 °C(Predicted) | density | 1.10±0.1 g/cm3(Predicted) | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | form | Solid | pka | 14.68±0.70(Predicted) | color | White to Off-White | InChI | InChI=1S/C15H26N2O4/c1-5-9(3)21-13-8-11(15(19)20-6-2)7-12(16)14(13)17-10(4)18/h8-9,12-14H,5-7,16H2,1-4H3,(H,17,18)/t9?,12-,13+,14+/m0/s1 | InChIKey | DVWBSYTVGZEABZ-IPCIMUCLSA-N | SMILES | C1(C(OCC)=O)C[C@H](N)[C@@H](NC(C)=O)[C@H](OC(C)CC)C=1 |
| 3-Des(1-ethylpropoxy)-3-(1-Methylpropoxy) OseltaMivir Usage And Synthesis |
Uses | 3-Des(1-ethylpropoxy)-3-(1-methylpropoxy) Oseltamivir (Oseltamivir EP Impurity F) is an impurity of the antiviral drug Oseltamivir (O700100). It is a COVID19-related research product. | Physiological effects | 3-Des(1-ethylpropoxy)-3-(1-methylpropoxy) Oseltamivir is A metabolite of Oseltamivir, which is an acetamido cyclohexene that is a structural homolog of sialic acid and inhibits neuraminidase. |
| 3-Des(1-ethylpropoxy)-3-(1-Methylpropoxy) OseltaMivir Preparation Products And Raw materials |
|