|
| | trichloro(N,N-dimethyloctylamine)boron Basic information |
| Product Name: | trichloro(N,N-dimethyloctylamine)boron | | Synonyms: | trichloro(N,N-dimethyloctylamine)boron;Boron, trichloro(N,N-dimethyl-1-octanamine)-, (T-4)-;Octyldimethylamine, trichloroborane complex;Octyldimethylamine,trichloroborane complex;trichloro(N,N-dimethyl-1-octanamine)-, (T-4)-Boron;Boron trichloride-dimethyloctylamine complex;N,N-dimethyloctan-1-amine;Omicure BC-120 | | CAS: | 34762-90-8 | | MF: | C10H23BCl3N | | MW: | 274.46632 | | EINECS: | 252-200-4 | | Product Categories: | Organometallics | | Mol File: | 34762-90-8.mol |  |
| | trichloro(N,N-dimethyloctylamine)boron Chemical Properties |
| density | 1.148[at 20℃] | | vapor pressure | 0.021Pa at 25℃ | | Water Solubility | 940μg/L at 20℃ | | InChI | InChI=1S/C10H23BCl3N/c1-4-5-6-7-8-9-10-15(2,3)11(12,13)14/h4-10H2,1-3H3 | | InChIKey | FXWXWPYCGVUYAA-UHFFFAOYSA-N | | SMILES | [B-](Cl)(Cl)(Cl)[N+](C)(C)CCCCCCCC | | LogP | 5.77 at 25℃ | | EPA Substance Registry System | Boron, trichloro(N,N-dimethyl-1-octanamine)-, (T-4)- (34762-90-8) |
| | trichloro(N,N-dimethyloctylamine)boron Usage And Synthesis |
| Flammability and Explosibility | Nonflammable |
| | trichloro(N,N-dimethyloctylamine)boron Preparation Products And Raw materials |
|
