|
| 5-Chloro-2,3-difluoropyridine Basic information |
| 5-Chloro-2,3-difluoropyridine Chemical Properties |
Melting point | 47-49 C | Boiling point | 135°C | density | 1.442 g/mL at 25 °C | refractive index | 1.4738 | Fp | 135°C | storage temp. | 2-8°C | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | form | Oil | pka | -5.14±0.20(Predicted) | color | Clear Colourless | BRN | 4177319 | InChI | InChI=1S/C5H2ClF2N/c6-3-1-4(7)5(8)9-2-3/h1-2H | InChIKey | PERMDYZFNQIKBL-UHFFFAOYSA-N | SMILES | C1(F)=NC=C(Cl)C=C1F | CAS DataBase Reference | 89402-43-7(CAS DataBase Reference) |
Provider | Language |
ALFA
| English |
| 5-Chloro-2,3-difluoropyridine Usage And Synthesis |
Uses | 5-Chloro-2,3-difluoropyridine is a 2,3,5-trihalopyridine used in the preparation of the herbicides and pesticides such as chodinafop-propargyl. |
| 5-Chloro-2,3-difluoropyridine Preparation Products And Raw materials |
|