|
| | Growth hormone releasing peptide Basic information |
| Product Name: | Growth hormone releasing peptide | | Synonyms: | D-TRP7,ALA8,D-PHE10]-A-MELANOCYTESTIMULATINGHORMONEAMIDEFRAGMENT6-11;(2S)-6-amino-2-[[2-[[(2S)-2-[[(2S)-2-[[(2R)-2-[[(2S)-2-amino-3-(3H-imidazol-4-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-phenyl-propanoyl]amino]hexanamide;Growth hormone releasing peptide;(D-trp7,ala8,D-phe10)-A-melanocyte*stimulating ho;(D-TRP7,ALA8,D-PHE10)-A-MELANOCYTE*STIMU LATING HORM;Growth;[d-trp7, ala8, d-phe10]-α-melanocyte stimulating hormone amide fragment 6-11;High Purity Ghrp-6 Peptide For Lean Muscle Mass CAS NO.87616-84-0 CAS NO.87616-84-0 | | CAS: | 87616-84-0 | | MF: | C46H56N12O6 | | MW: | 873.01 | | EINECS: | 212-729-3 | | Product Categories: | Peptide;GHRP6;hgh;87616-84-0 | | Mol File: | 87616-84-0.mol |  |
| | Growth hormone releasing peptide Chemical Properties |
| Melting point | >160o C (Dec.) | | Boiling point | 1407.0±65.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 13.42±0.46(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C46H56N12O6/c1-27(54-44(62)39(20-29-23-51-35-15-7-5-13-32(29)35)57-43(61)34(48)22-31-25-50-26-53-31)42(60)56-40(21-30-24-52-36-16-8-6-14-33(30)36)46(64)58-38(19-28-11-3-2-4-12-28)45(63)55-37(41(49)59)17-9-10-18-47/h2-8,11-16,23-27,34,37-40,51-52H,9-10,17-22,47-48H2,1H3,(H2,49,59)(H,50,53)(H,54,62)(H,55,63)(H,56,60)(H,57,61)(H,58,64)/t27-,34-,37-,38+,39+,40-/m0/s1 | | InChIKey | WZHKXNSOCOQYQX-FUAFALNISA-N | | SMILES | C(N)(=O)[C@H](CCCCN)NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CC1C2=C(C=CC=C2)NC=1)NC(=O)[C@H](C)NC(=O)[C@@H](CC1C2=C(C=CC=C2)NC=1)NC(=O)[C@H](CC1N=CNC=1)N | | CAS DataBase Reference | 87616-84-0(CAS DataBase Reference) |
| | Growth hormone releasing peptide Usage And Synthesis |
| Description | Growth hormone-releasing peptides (GHRPs) are synthetic, non-natural peptides endowed with potent stimulatory effects on somatotrope secretion in animals and humans. They have no structural homology with GHRH and act via specific receptors present either at the pituitary or the hypothalamic level both in animals and in humans. | | Uses | L-Histidyl-D-tryptophyl-L-alanyl-L-tryptophyl-D-phenylalanyl-L-lysinamide is a growth hormone releasing peptide. | | Uses | Growth hormone releasing peptide-6 can promote the secretion of growth hormone, regulate food intake, increase weight, and promote animal growth. | | Mechanism of action | Growth hormone releasing peptide is generally accepted that GHRPs stimulate the release of GH by acting at the level of the pituitary through a receptor different to that for the endogenous GH-releasing hormone (GHRH). In addition, it has been reported that there are specific binding sites for these peptides in the hypothalamus and that systemic administration of GHRPs increases the expression of the immediate early gene c-fos in a subpopulation of hypothalamic neurons. | | Side effects | Carpal tunnel syndrome.Increased insulin resistance.
Type 2 diabetes.
Swelling in the arms and legs (edema)
Joint and muscle pain.
For men, enlargement of breast tissue (gynecomastia).
Increased risk of certain cancers. | | Physiological effects | Growth hormone releasing peptide (GHRP) is a cyclase inhibitor that blocks the release of endogenous growth hormone.The peptide acts on both igf-i and somatotrophs, with receptor activity in the hypothalamus.GHRP can be used to increase body weight and control obesity.It has been shown to stimulate cell division and inhibit apoptosis in vitro.
|
| | Growth hormone releasing peptide Preparation Products And Raw materials |
|
