|
| 2,3-Difluorotoluene Basic information |
| 2,3-Difluorotoluene Chemical Properties |
Boiling point | 119-121 °C (lit.) | density | 1.096 g/mL at 25 °C (lit.) | refractive index | n20/D 1.4530(lit.) | Fp | 15°C | storage temp. | Sealed in dry,Room Temperature | solubility | 0.24g/l | form | liquid | Specific Gravity | 1.120 | color | Clear, faint lemon/lime | BRN | 3235341 | InChI | InChI=1S/C7H6F2/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3 | InChIKey | ZNEHIDGAPGVZSA-UHFFFAOYSA-N | SMILES | C1(F)=CC=CC(C)=C1F | CAS DataBase Reference | 3828-49-7(CAS DataBase Reference) |
Hazard Codes | Xn,F | Risk Statements | 10-22-37/38-41 | Safety Statements | 16-26-39 | RIDADR | UN 1993 3/PG 2 | WGK Germany | 2 | Hazard Note | Flammable | HazardClass | 3 | PackingGroup | II | HS Code | 29039990 |
| 2,3-Difluorotoluene Usage And Synthesis |
Chemical Properties | colorless to light yellow liqui |
| 2,3-Difluorotoluene Preparation Products And Raw materials |
|