|
| | 3,5-DIPHENYLPYRAZOLE Basic information |
| Product Name: | 3,5-DIPHENYLPYRAZOLE | | Synonyms: | 3,5-Diphenyl-1H-pyrazole, 98+%;3,5-Diphenylpyrazole,99%;1H-Pyrazole, 3,5-diphenyl-;1H-Pyrazole,3,5-diphenyl-;3,5-diphenyl-1h-pyrazol;Pyrazole, 3,5-diphenyl-;Pyrazole,3,5-diphenyl-;3,5-DIPHENYLPYRAZOLE | | CAS: | 1145-01-3 | | MF: | C15H12N2 | | MW: | 220.27 | | EINECS: | 214-543-8 | | Product Categories: | Heterocyclic Compounds;Building Blocks;Heterocyclic Building Blocks;Pyrazoles | | Mol File: | 1145-01-3.mol |  |
| | 3,5-DIPHENYLPYRAZOLE Chemical Properties |
| Melting point | 199-203 °C (lit.) | | Boiling point | 351.21°C (rough estimate) | | density | 1.1405 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.04±0.10(Predicted) | | form | Crystalline Powder | | color | White | | BRN | 158264 | | InChI | InChI=1S/C15H12N2/c1-3-7-12(8-4-1)14-11-15(17-16-14)13-9-5-2-6-10-13/h1-11H,(H,16,17) | | InChIKey | JXHKUYQCEJILEI-UHFFFAOYSA-N | | SMILES | N1C(C2=CC=CC=C2)=CC(C2=CC=CC=C2)=N1 | | EPA Substance Registry System | 1H-Pyrazole, 3,5-diphenyl- (1145-01-3) |
| | 3,5-DIPHENYLPYRAZOLE Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Synthesis Reference(s) | Journal of the American Chemical Society, 89, p. 985, 1967 DOI: 10.1021/ja00980a041 |
| | 3,5-DIPHENYLPYRAZOLE Preparation Products And Raw materials |
|
