|
| 4,5-Difluorophthalic acid Basic information |
Product Name: | 4,5-Difluorophthalic acid | Synonyms: | 4,5-Difluorobenzene-1,2-dicarboxylic acid;4,5-Difluorophthalic acid;1,2-Benzenedicarboxylic acid, 4,5-difluoro-;4,5-Difluorophthalicaci;DK7703;4,5-difluorobenzene-1,2-dioic acid;Ethyl Acetate Impurity 5 | CAS: | 18959-31-4 | MF: | C8H4F2O4 | MW: | 202.11 | EINECS: | | Product Categories: | | Mol File: | 18959-31-4.mol |  |
| 4,5-Difluorophthalic acid Chemical Properties |
Melting point | 161.5-162 °C | Boiling point | 378.7±42.0 °C(Predicted) | density | 1.644±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | pka | 2.55±0.10(Predicted) | InChI | InChI=1S/C8H4F2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14) | InChIKey | FFSBOABNRUJQFW-UHFFFAOYSA-N | SMILES | C1(C(O)=O)=CC(F)=C(F)C=C1C(O)=O |
| 4,5-Difluorophthalic acid Usage And Synthesis |
| 4,5-Difluorophthalic acid Preparation Products And Raw materials |
|