|
| | THIOPHENE-3,4-DICARBOXYLIC ACID Basic information |
| Product Name: | THIOPHENE-3,4-DICARBOXYLIC ACID | | Synonyms: | THIOPHENE-3,4-DICARBOXYLIC ACID;3,4-Thiophenedicarboxylic acid,97%;3,4-Dicarboxythiophene;3,4-Thiophenedicarboxylic acid ,98%;THIOPHENE-3,4-DICARBOXYLATE;THIOPHENE-3,4-DICARBOXY;Thiophene-3,4-DicarboxylicAci;THIOPHENE-3,4-DICARBOXYLIC ACID ISO 9001：2015 REACH | | CAS: | 4282-29-5 | | MF: | C6H4O4S | | MW: | 172.16 | | EINECS: | | | Product Categories: | Building Blocks;Carboxy;Thiophene;API intermediates;Acids and Derivatives;Heterocycles | | Mol File: | 4282-29-5.mol |  |
| | THIOPHENE-3,4-DICARBOXYLIC ACID Chemical Properties |
| Melting point | 227-231 °C | | Boiling point | 272.46°C (rough estimate) | | density | 1.473 (estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Crystalline Powder | | pka | 3.36±0.20(Predicted) | | color | Yellow to beige-pinkish or light brown | | λmax | 240nm(H2O)(lit.) | | InChI | InChI=1S/C6H4O4S/c7-5(8)3-1-11-2-4(3)6(9)10/h1-2H,(H,7,8)(H,9,10) | | InChIKey | ZWWLLYJRPKYTDF-UHFFFAOYSA-N | | SMILES | C1SC=C(C(O)=O)C=1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29349990 |
| Provider | Language |
|
ACROS
| English |
| | THIOPHENE-3,4-DICARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | yellow to beige-pinkish or light brown crystalline | | Uses | Synthetic precursor for organic electronics materials. | | Uses | Thiophene-3,4-dicarboxylic Acid is used in preparation of dibromo thienofuran dione. |
| | THIOPHENE-3,4-DICARBOXYLIC ACID Preparation Products And Raw materials |
| Raw materials | N,N-Dimethylformamide-->Ferric chloride-->Copper(I) Cyanide-->3,4-Dibromothiophene-->2-Butenedioic acid, 2,3-dimethyl-, dimethyl ester, (2Z)--->diethyl 2-(diethoxymethyl)butanedioate-->2-(Diethoxymethyl)-3-formylbutanedioic acid diethyl ester-->3,4-Diiodothiophene-->3,4-Thiophenedicarboxylic acid, diMethyl ester-->DIETHYL FORMYLSUCCINATE-->2,3-Dimethylmaleic anhydride-->3,4-DICYANOTHIOPHENE,-->3,4-Thiophenedicarboxylic acid, diethyl ester-->3,4-Thiophenedicarboxylic acid, 2,5-dihydro-, dimethyl ester-->CARBON DIOXIDE | | Preparation Products | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione-->4-BROMOTHIOPHENE-3-CARBOXYLIC ACID |
|
