|
| | N-Benzylglycine ethyl ester Basic information |
| | N-Benzylglycine ethyl ester Chemical Properties |
| Boiling point | 140-142 °C/10 mmHg (lit.) | | density | 1.031 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.506(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | Liquid | | pka | 6.84±0.20(Predicted) | | color | Clear colorless to light yellow | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 2104816 | | InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)9-12-8-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3 | | InChIKey | ULOLIZHBYWAICY-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CNCC1=CC=CC=C1 | | CAS DataBase Reference | 6436-90-4(CAS DataBase Reference) | | NIST Chemistry Reference | N-Benzylglycine ethyl ester(6436-90-4) |
| | N-Benzylglycine ethyl ester Usage And Synthesis |
| Chemical Properties | clear colourless to light yellow liquid | | Uses | N-Benzylglycine ethyl ester is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff field. |
| | N-Benzylglycine ethyl ester Preparation Products And Raw materials |
| Raw materials | ethyl 2-{benzyl[(tert-butoxy)carbonyl]amino}acetate-->DIETHYL BENZYLIMINODIACETATE 97-->ETHYL HIPPURATE | | Preparation Products | 1-Methylpiperazin-2-one-->(S)-4-(Phenylmethyl)-2-piperazineethanol-->N-Benzylglycine-->methyl 2-(benzylamino)acetate-->tert-butyl benzyl(2-oxoethyl)carbamate-->7-BENZYL-5,6,7,8-TETRAHYDRO4-CHLORO-PYRIDO[3,4-D]PYRIMIDINE HYDROCHLORIDE-->Glycine, N-ethyl-N-(phenylmethyl)-, ethyl ester-->Cyclopenta[b]pyrrole-2-carboxylic acid, 1,4,5,6-tetrahydro-1-(phenylmethyl)-, ethyl ester-->(R)-N4-Benzyl-2-(benzyloxymethyl)piperazine |
|
