|
| | Tetrabutylammonium hexafluorophosphate Basic information |
| | Tetrabutylammonium hexafluorophosphate Chemical Properties |
| Melting point | 244-246 °C (lit.) | | Boiling point | 242-246 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | acetonitrile: 0.1 g/mL, clear, colorless | | form | Crystalline Powder and/or Chunks | | color | White to off-white | | Sensitive | Hygroscopic | | BRN | 4056584 | | InChI | InChI=1S/C16H36N.F6P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-7(2,3,4,5)6/h5-16H2,1-4H3;/q+1;-1 | | InChIKey | BKBKEFQIOUYLBC-UHFFFAOYSA-N | | SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[P-](F)(F)(F)(F)(F)F | | CAS DataBase Reference | 3109-63-5(CAS DataBase Reference) | | NIST Chemistry Reference | Tetrabutylammonium hexafluorophosphate(3109-63-5) | | EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, hexafluorophosphate(1-) (3109-63-5) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37 | | RIDADR | 1759 | | WGK Germany | 3 | | Hazard Note | Irritant/Hygroscopic | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29239000 |
| | Tetrabutylammonium hexafluorophosphate Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | Tetrabutylammonium hexafluorophosphate can be used as a supporting electrolyte for the formation of cyclic disulfide moiety of 3,5-diimido-1,2-dithiolane derivatives by S-S coupling of dithioanilides. | | Uses | Tetrabutylammonium hexafluorophosphate (TBAPF6) or TBAHP can be used:
- As the supporting electrolyte in cyclic voltammetric studies.
- As a reactant in the synthesis of fluorescent nanofibrous sensing films for detecting nitro-explosive vapors.
| | General Description | Visit our Sensor Applications portal to learn more. | | Purification Methods | Recrystallise it from saturated EtOH/water and dry it for 10hours in a vacuum at 70o. Also recrystallise it three times from absolute EtOH and dry it for 2 days in a drying pistol under a vacuum at boiling toluene temperature [Bedard & Dahl J Am Chem Soc 108 5933 1986]. It is a stable supporting electrolyte in organic solvents [Baiser in Organic Electrochemitry M. Dekker NY p228 1973.] |
| | Tetrabutylammonium hexafluorophosphate Preparation Products And Raw materials |
|
