|
| | 2,5-Dibromopyridine Basic information |
| Product Name: | 2,5-Dibromopyridine | | Synonyms: | 2,5-DIBROMOPYRIDINE;PYRIDINE, 2,5-DIBROMO-;2,5-Dibromopyridine, 97+%;2,5-dibromopyridin;2,5-DIBROMOPYRIDINE 2,5-DIBROMOPYRIDINE;2,5-Dibromo pyridine ,98%;2,5-DibroMopyridine, 97% 10GR;3,6-DibroMopyridine | | CAS: | 624-28-2 | | MF: | C5H3Br2N | | MW: | 236.89 | | EINECS: | 210-839-6 | | Product Categories: | alkyl bromide;Building Blocks;C5;Chemical Synthesis;Halogenated Heterocycles;Heterocyclic Building Blocks;Brominated heterocyclic series;Aromatics;Bases & Related Reagents;Nucleotides;Aromatics Compounds;Bromopyridines;Halopyridines;Pyridine series;C5Heterocyclic Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Nitrogen cyclic compounds;blocks;Bromides;Pyridines;pyridine derivative;Pyridines, Pyrimidines, Purines and Pteredines;Halides;Pyridine;Pyridines derivates;bc0001;624-28-2 | | Mol File: | 624-28-2.mol |  |
| | 2,5-Dibromopyridine Chemical Properties |
| Melting point | 92-95 °C (lit.) | | Boiling point | 235 °C / 772mmHg | | density | 2.0383 (rough estimate) | | refractive index | 1.5800 (estimate) | | Fp | 62℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | pka | -1.57±0.10(Predicted) | | color | Almost white or light beige to brown | | Water Solubility | insoluble | | BRN | 109099 | | InChI | InChI=1S/C5H3Br2N/c6-4-1-2-5(7)8-3-4/h1-3H | | InChIKey | ZHXUWDPHUQHFOV-UHFFFAOYSA-N | | SMILES | C1(Br)=NC=C(Br)C=C1 | | CAS DataBase Reference | 624-28-2(CAS DataBase Reference) |
| | 2,5-Dibromopyridine Usage And Synthesis |
| Chemical Properties | 2,5-Dibromopyridine is an off-white crystalline solid. It is insoluble in water but soluble in strong polar organic solvents. It exhibits strong alkalinity. | | Uses | 2,5-Dibromopyridine (cas# 624-28-2) is a compound useful in organic synthesis. | | Preparation | To synthesize 2,5-dibromopyridine, follow these steps:
Add 2-amino-5-bromopyridine (13.0 kg) into a water-cooled solution at 10 °C.
Slowly add 47% aqueous hydrogen bromide (37 L) to the mixture.
Introduce liquid bromine (11 L) into the mixture.
Maintain the reaction temperature below 10 °C.
Prepare a solution of NaNO2 (16.1 kg) and H2O (19 L) and add it dropwise to the mixture while keeping the temperature between 0-5 °C.
Stir the reaction mixture for 30 minutes.
Treat the mixture with a solution of NaOH (28.0 kg) in water (30 L) at a controlled rate below 20-25 °C.
Extract the reaction mixture with diethyl ether (3 × 40 L).
Dry the organic layer with anhydrous Na2SO4.
Remove the desiccant by filtration.
Evaporate the resulting filtrate under reduced pressure to dryness.
Suspend the residue in heptane (10 L).
Collect the target product molecule, 2,5-dibromopyridine, by filtration.
Synthesis method of 2,5-dibromopyridine |
| | 2,5-Dibromopyridine Preparation Products And Raw materials |
|
