|
| | 9,9-BIS(METHOXYMETHYL)FLUORENE Basic information |
| Product Name: | 9,9-BIS(METHOXYMETHYL)FLUORENE | | Synonyms: | 9,9-BIS(METHOXYMETHYL)FLUORENE;9,9-Di(methoxymethyl)fluorene;FP 1;9,9-Bis(MethoxyMethyl)fluorine(BMMF);9H-Fluorene,9,9-bis(MethoxyMethyl)-;9,9-Bis(methoxymethyL;China biggest manufacturer 9,9-BIS(METHOXYMETHYL)FLUORENE 182121-12-6;9,9-Bis (Methoxy group methyl) fluorene | | CAS: | 182121-12-6 | | MF: | C17H18O2 | | MW: | 254.32 | | EINECS: | 682-678-3 | | Product Categories: | | | Mol File: | 182121-12-6.mol |  |
| | 9,9-BIS(METHOXYMETHYL)FLUORENE Chemical Properties |
| Boiling point | 359.9±15.0 °C(Predicted) | | density | 1.083 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | color | White | | InChI | InChI=1S/C17H18O2/c1-18-11-17(12-19-2)15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10H,11-12H2,1-2H3 | | InChIKey | ZWINORFLMHROGF-UHFFFAOYSA-N | | SMILES | C1(COC)(COC)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| | 9,9-BIS(METHOXYMETHYL)FLUORENE Usage And Synthesis |
| Description | 9,9-Bis(methoxymethyl)-fluorene is a compound involved in the preparation of polypropylene by heterogeneous Ziegler-Natta catalyst. | | Uses | 9,9-Bis(methoxymethyl)-fluorene is a hydrocarbon organic matter and can be used as pharmaceutical intermediates. | | Application | Using 9,9-Bis(methoxymethyl) fluorene as the internal electron donor of Ziegler-Natta catalyst, polypropylene with relatively narrow molecular mass distribution, high isometric and good mechanical properties could be prepared. In addition, the compound can also be used as an intermediate, through polymerization reaction or functional group, applied to materials or drug molecules and other domains. Therefore, the compound has a wide range of applications.
|
| | 9,9-BIS(METHOXYMETHYL)FLUORENE Preparation Products And Raw materials |
|
